[(1S,3S,4S,6S,9R,10S,11R,12R,13R)-3,6,12-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate
Internal ID | fe6c99fa-9c53-4f5b-a0dd-fedf0de025bb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1S,3S,4S,6S,9R,10S,11R,12R,13R)-3,6,12-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
SMILES (Canonical) | CC(=O)OC1C(C2CC3(C1C4(CCC(C(C4C(C3)O)(C)C)O)C)C(=O)C2=C)O |
SMILES (Isomeric) | CC(=O)O[C@H]1[C@@H]([C@@H]2C[C@]3([C@@H]1[C@@]4(CC[C@@H](C([C@H]4[C@H](C3)O)(C)C)O)C)C(=O)C2=C)O |
InChI | InChI=1S/C22H32O6/c1-10-12-8-22(19(10)27)9-13(24)17-20(3,4)14(25)6-7-21(17,5)18(22)16(15(12)26)28-11(2)23/h12-18,24-26H,1,6-9H2,2-5H3/t12-,13+,14+,15-,16+,17-,18+,21-,22+/m1/s1 |
InChI Key | LQXDPFOVHUBZHG-FKIQNOAQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H32O6 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.33% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.57% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.89% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.08% | 98.95% |
CHEMBL204 | P00734 | Thrombin | 90.05% | 96.01% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.48% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.17% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.83% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.82% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.22% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.12% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.97% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.55% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.06% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.02% | 92.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.86% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.00% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon melissoides |
Isodon rubescens |
PubChem | 162939482 |
LOTUS | LTS0176427 |
wikiData | Q105155937 |