(1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol
| Internal ID | da1bd175-ecb9-4f13-ad59-23c0b139bbc9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol |
| SMILES (Canonical) | CC1(CCCC2(C1C=CC(C2CCC(C)(C=C)O)(C)O)C)C |
| SMILES (Isomeric) | C[C@]12CCCC([C@@H]1C=C[C@@]([C@@H]2CC[C@](C)(C=C)O)(C)O)(C)C |
| InChI | InChI=1S/C20H34O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,10,14-16,21-22H,1,8-9,11-13H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChI Key | ITSDQXSGDXLEJV-HHUCQEJWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol](https://plantaedb.com/storage/docs/compounds/2023/11/8e523550-85e3-11ee-ba81-e3e77be58ac0.jpg "2D Structure of (1R,2R,4aS,8aS)-1-[(3R)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-4a,6,7,8-tetrahydro-1H-naphthalen-2-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.68% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.84% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.87% | 91.49% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.83% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.37% | 96.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.36% | 90.93% |
| CHEMBL233 | P35372 | Mu opioid receptor | 89.20% | 97.93% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 88.71% | 95.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.67% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.35% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.82% | 98.95% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.74% | 97.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.61% | 91.07% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.46% | 93.99% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 84.21% | 99.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.28% | 100.00% |
| CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 82.47% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.95% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.76% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplopappus parvifolius |
| PubChem | 101616665 |
| LOTUS | LTS0071335 |
| wikiData | Q105120267 |