[(3aR,4S,5aR,9aS,9bR)-5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl] (E)-2-methylbut-2-enoate
| Internal ID | 2e9219af-cf82-4e96-b04f-62cd8fd9e018 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(3aR,4S,5aR,9aS,9bR)-5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl] (E)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1CC2(C(C3C1C(=C)C(=O)O3)C(=C)COC2=O)C=C |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@H]1C[C@]2([C@@H]([C@@H]3[C@@H]1C(=C)C(=O)O3)C(=C)COC2=O)C=C |
| InChI | InChI=1S/C20H22O6/c1-6-10(3)17(21)25-13-8-20(7-2)15(11(4)9-24-19(20)23)16-14(13)12(5)18(22)26-16/h6-7,13-16H,2,4-5,8-9H2,1,3H3/b10-6+/t13-,14+,15+,16-,20-/m0/s1 |
| InChI Key | WSJQJFJGCHEPNW-LVUWFRGTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 78.90 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.68% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.61% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.49% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.12% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.90% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.25% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.42% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Jurinea leptoloba |
| PubChem | 15694354 |
| LOTUS | LTS0083176 |
| wikiData | Q105311898 |