(8E)-4,9,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-8-en-13-one
| Internal ID | 821e0447-0808-47ea-83a7-8edd441b5bf1 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | (8E)-4,9,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-8-en-13-one |
| SMILES (Canonical) | CC1C2CC(=CCCCC3(C(C2OC1=O)O3)C)C |
| SMILES (Isomeric) | CC1C2C/C(=C/CCCC3(C(C2OC1=O)O3)C)/C |
| InChI | InChI=1S/C15H22O3/c1-9-6-4-5-7-15(3)13(18-15)12-11(8-9)10(2)14(16)17-12/h6,10-13H,4-5,7-8H2,1-3H3/b9-6+ |
| InChI Key | CIGIQOGMEIBBRJ-RMKNXTFCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 38.80 Ų |
| XlogP | 2.40 |
| NSC-113091 |
![2D Structure of (8E)-4,9,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-8-en-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/8e-4912-trimethyl-314-dioxatricyclo930024tetradec-8-en-13-one.jpg "2D Structure of (8E)-4,9,12-trimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-8-en-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.52% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.45% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.02% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.67% | 86.33% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.41% | 86.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.56% | 95.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.84% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.63% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.42% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.24% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.41% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.26% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Magnolia compressa |
| PubChem | 5381212 |
| LOTUS | LTS0273098 |
| wikiData | Q105102606 |