[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-methoxyphenoxy]-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
| Internal ID | a1802dd9-c8ff-4c0c-8faa-2cc45cd8c85e |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-methoxyphenoxy]-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=CC(=C3)OC)C=CC4=CC=C(C=C4)O)OC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=CC(=C3)OC)/C=C/C4=CC=C(C=C4)O)OC(=O)/C=C/C5=CC(=C(C=C5)O)OC)O)O)O)O)O |
| InChI | InChI=1S/C37H42O15/c1-19-30(41)32(43)34(45)36(49-19)48-18-28-31(42)33(44)35(52-29(40)13-9-21-8-12-26(39)27(16-21)47-3)37(51-28)50-25-15-22(14-24(17-25)46-2)5-4-20-6-10-23(38)11-7-20/h4-17,19,28,30-39,41-45H,18H2,1-3H3/b5-4+,13-9+/t19-,28+,30-,31+,32+,33-,34+,35+,36+,37+/m0/s1 |
| InChI Key | CSWKRTAAWHZWCC-QJVMLNMPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C37H42O15 |
| Molecular Weight | 726.70 g/mol |
| Exact Mass | 726.25237063 g/mol |
| Topological Polar Surface Area (TPSA) | 223.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.70% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.55% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.39% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.70% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 95.33% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.71% | 95.56% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.06% | 97.36% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.04% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.95% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.90% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.41% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.02% | 90.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.68% | 85.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.83% | 99.15% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.58% | 97.09% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.67% | 80.78% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.18% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eleutherococcus brachypus |
| PubChem | 102422499 |
| LOTUS | LTS0089407 |
| wikiData | Q104969627 |