(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one
Internal ID | 4b790e1c-bb42-4409-b470-59e03e8a24e1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one |
SMILES (Canonical) | CC1C2C(CC3C2(C(=O)CC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)O)O)O)C)C)OC18CCC(CO8)CO |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(C(=O)C[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)C)C)O[C@]18CC[C@H](CO8)CO |
InChI | InChI=1S/C39H60O15/c1-17-28-24(54-39(17)9-6-18(13-40)16-49-39)11-23-21-5-4-19-10-20(7-8-37(19,2)22(21)12-27(43)38(23,28)3)50-35-33(48)31(46)34(26(15-42)52-35)53-36-32(47)30(45)29(44)25(14-41)51-36/h4,17-18,20-26,28-36,40-42,44-48H,5-16H2,1-3H3/t17-,18-,20-,21+,22-,23-,24-,25+,26+,28-,29+,30-,31-,32+,33+,34-,35+,36-,37-,38+,39+/m0/s1 |
InChI Key | HPTXQTQVCDPYLH-QPOFDZLCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H60O15 |
Molecular Weight | 768.90 g/mol |
Exact Mass | 768.39322120 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one 2D Structure of (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/8d1f2f10-87ff-11ee-9fff-653c63542204.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.14% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.48% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.13% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.32% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.49% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.23% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.83% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.51% | 91.24% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.34% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.51% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.16% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.87% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.72% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.34% | 92.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.84% | 94.23% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.39% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.97% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.71% | 94.73% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.17% | 93.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.13% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygonatum zanlanscianense |
PubChem | 163104317 |
LOTUS | LTS0106673 |
wikiData | Q105031888 |