Methyl 13-hydroxy-5,7,11,15,15,19-hexamethyl-4-methylidene-6,9,12,16-tetraoxo-2,8-dioxapentacyclo[9.8.0.01,3.05,10.014,19]nonadec-13-ene-7-carboxylate
| Internal ID | 27d9e49a-ebcf-40ad-a262-a9c1bf8c9a34 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | methyl 13-hydroxy-5,7,11,15,15,19-hexamethyl-4-methylidene-6,9,12,16-tetraoxo-2,8-dioxapentacyclo[9.8.0.01,3.05,10.014,19]nonadec-13-ene-7-carboxylate |
| SMILES (Canonical) | CC1(C(=O)CCC2(C1=C(C(=O)C3(C24C(O4)C(=C)C5(C3C(=O)OC(C5=O)(C)C(=O)OC)C)C)O)C)C |
| SMILES (Isomeric) | CC1(C(=O)CCC2(C1=C(C(=O)C3(C24C(O4)C(=C)C5(C3C(=O)OC(C5=O)(C)C(=O)OC)C)C)O)C)C |
| InChI | InChI=1S/C26H30O9/c1-11-17-26(34-17)22(4)10-9-12(27)21(2,3)14(22)13(28)16(29)24(26,6)15-18(30)35-25(7,20(32)33-8)19(31)23(11,15)5/h15,17,28H,1,9-10H2,2-8H3 |
| InChI Key | TUFJOFANNIXESE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18898253 g/mol |
| Topological Polar Surface Area (TPSA) | 137.00 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.74% | 94.45% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 94.17% | 91.23% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.13% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.00% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.36% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.20% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.23% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.78% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.10% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.70% | 95.56% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.80% | 92.88% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.78% | 98.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.30% | 91.24% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.18% | 93.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.47% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162822944 |
| LOTUS | LTS0122588 |
| wikiData | Q104197836 |