[(10R,11R,12R,13S,15R)-3,4,5,12,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate
Internal ID | f6da3137-051f-4035-986e-2c096a8969f1 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(10R,11R,12R,13S,15R)-3,4,5,12,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C6C7=C5C(=O)OC8=C7C(=CC(=C8O)O)C(=O)O6)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C6C7=C5C(=O)OC8=C7C(=CC(=C8O)O)C(=O)O6)O)O)O)O)O)OC(=O)C9=CC(=C(C(=C9C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C48H30O30/c49-13-1-8(2-14(50)27(13)55)42(66)78-48-37(65)41(38-19(73-48)7-72-43(67)9-3-15(51)28(56)32(60)20(9)21-10(44(68)74-38)4-16(52)29(57)33(21)61)77-45(69)11-5-17(53)30(58)34(62)22(11)24-26-25-23-12(46(70)75-40(25)36(64)35(24)63)6-18(54)31(59)39(23)76-47(26)71/h1-6,19,37-38,41,48-65H,7H2/t19-,37-,38-,41-,48+/m1/s1 |
InChI Key | XELJXAUWYMOREZ-YCVVSIEOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H30O30 |
Molecular Weight | 1086.70 g/mol |
Exact Mass | 1086.08218953 g/mol |
Topological Polar Surface Area (TPSA) | 511.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of [(10R,11R,12R,13S,15R)-3,4,5,12,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate 2D Structure of [(10R,11R,12R,13S,15R)-3,4,5,12,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-11-yl] 3,4,5-trihydroxy-2-(6,7,13,14-tetrahydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,11,13-hexaen-5-yl)benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/8cbd72a0-8582-11ee-bcab-bd61ae48686d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.26% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.56% | 89.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.24% | 95.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.99% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 93.58% | 83.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.42% | 89.34% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.53% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.95% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.55% | 95.56% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.92% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.33% | 95.89% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.99% | 94.42% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.93% | 89.63% |
CHEMBL3194 | P02766 | Transthyretin | 86.74% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 83.78% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.49% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.93% | 97.36% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.66% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.62% | 99.17% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.60% | 83.57% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.95% | 97.31% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.86% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.58% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.00% | 86.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.15% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rhoiptelea chiliantha |
PubChem | 16146721 |
LOTUS | LTS0218164 |
wikiData | Q105326417 |