Acetic acid, 4,4,6a,6b,8a,11,12,14b-octamethyl-14-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-eicosahydropicen-3-yl ester
Internal ID | c22aba8d-14f6-48c7-8224-5a190acae3a8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4,4,6a,6b,8a,11,12,14b-octamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-3-yl) acetate |
SMILES (Canonical) | CC1CCC2(CCC3(C(=CC(=O)C4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2C1C)C)C |
SMILES (Isomeric) | CC1CCC2(CCC3(C(=CC(=O)C4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2C1C)C)C |
InChI | InChI=1S/C32H50O3/c1-19-10-13-29(6)16-17-31(8)22(26(29)20(19)2)18-23(34)27-30(7)14-12-25(35-21(3)33)28(4,5)24(30)11-15-32(27,31)9/h18-20,24-27H,10-17H2,1-9H3 |
InChI Key | JPJFFXBKQYGGMF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H50O3 |
Molecular Weight | 482.70 g/mol |
Exact Mass | 482.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 8.50 |
11-Oxours-12-en-3-yl acetate # |
Acetic acid, 4,4,6a,6b,8a,11,12,14b-octamethyl-14-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-eicosahydropicen-3-yl ester |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 96.46% | 94.78% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.42% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.93% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.78% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.39% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.54% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.05% | 95.56% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.81% | 85.30% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.43% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.32% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.62% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.34% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.21% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.03% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boswellia sacra |
Dendrophthoe falcata |
Morus mesozygia |
Populus tremuloides |
Taraxacum platycarpum |
PubChem | 623524 |
LOTUS | LTS0208682 |
wikiData | Q105132847 |