(1S,8R,9S,12S,16R)-8-hydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione
Internal ID | b1991f43-5997-4a9c-8207-0a6dcd3e4057 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,8R,9S,12S,16R)-8-hydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
SMILES (Canonical) | CC(C)C1=C2C(C3C4C(C2=CC(=O)O1)(CCCC4(C(=O)O3)C)C)O |
SMILES (Isomeric) | CC(C)C1=C2[C@H]([C@@H]3[C@@H]4[C@@](C2=CC(=O)O1)(CCC[C@@]4(C(=O)O3)C)C)O |
InChI | InChI=1S/C19H24O5/c1-9(2)14-12-10(8-11(20)23-14)18(3)6-5-7-19(4)16(18)15(13(12)21)24-17(19)22/h8-9,13,15-16,21H,5-7H2,1-4H3/t13-,15-,16-,18-,19+/m1/s1 |
InChI Key | STSHDWQMENTAMD-DZLVSBGCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O5 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.98% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.48% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.47% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.27% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.99% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.28% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.74% | 96.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.81% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.75% | 99.23% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.45% | 95.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.01% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.80% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.77% | 97.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.64% | 96.38% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.34% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.30% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nageia nagi |
PubChem | 162890396 |
LOTUS | LTS0238961 |
wikiData | Q105260594 |