[(2S)-2-tetradecanoyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] octadecanoate
Internal ID | 08e93770-767f-470e-a98b-7cbfd7092e5a |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosyldiacylglycerols |
IUPAC Name | [(2S)-2-tetradecanoyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] octadecanoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)OC(=O)CCCCCCCCCCCCC |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)OC(=O)CCCCCCCCCCCCC |
InChI | InChI=1S/C47H88O15/c1-3-5-7-9-11-13-15-16-17-18-20-21-23-25-27-29-38(49)57-32-35(60-39(50)30-28-26-24-22-19-14-12-10-8-6-4-2)33-58-46-45(56)43(54)41(52)37(62-46)34-59-47-44(55)42(53)40(51)36(31-48)61-47/h35-37,40-48,51-56H,3-34H2,1-2H3/t35-,36-,37-,40-,41-,42+,43+,44-,45-,46+,47+/m1/s1 |
InChI Key | LGYCXVJXWRPVSQ-GSYQMMAASA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H88O15 |
Molecular Weight | 893.20 g/mol |
Exact Mass | 892.61232210 g/mol |
Topological Polar Surface Area (TPSA) | 231.00 Ų |
XlogP | 10.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.58% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.58% | 92.50% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 96.07% | 85.94% |
CHEMBL2581 | P07339 | Cathepsin D | 93.81% | 98.95% |
CHEMBL299 | P17252 | Protein kinase C alpha | 93.08% | 98.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.26% | 91.11% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.73% | 97.29% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.23% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.14% | 95.17% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.93% | 92.86% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.07% | 94.73% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.02% | 92.08% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.63% | 97.25% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.38% | 82.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.71% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.38% | 96.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.25% | 97.79% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.93% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.50% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.38% | 96.47% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.34% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.65% | 93.56% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.10% | 92.32% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.61% | 94.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.03% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.37% | 91.19% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.33% | 91.81% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.26% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocimum tenuiflorum |
PubChem | 159347753 |
LOTUS | LTS0172097 |
wikiData | Q105151628 |