8beta-Propionyloxy-10beta-hydroxyhirsutinolide-13-O-acetate
| Internal ID | e329c547-a8ce-42bf-b622-8d5717ebd485 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1S,2E,8R,9S,10S,11R)-8-acetyloxy-10,11-dihydroxy-1,9,10-trimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl acetate |
| SMILES (Canonical) | CC1C(C2=C(C(=O)OC2=CC3(CCC(C1(C)O)(O3)O)C)COC(=O)C)OC(=O)C |
| SMILES (Isomeric) | C[C@H]1[C@H](C\2=C(C(=O)O/C2=C/[C@@]3(CC[C@]([C@@]1(C)O)(O3)O)C)COC(=O)C)OC(=O)C |
| InChI | InChI=1S/C20H26O9/c1-10-16(27-12(3)22)15-13(9-26-11(2)21)17(23)28-14(15)8-18(4)6-7-20(25,29-18)19(10,5)24/h8,10,16,24-25H,6-7,9H2,1-5H3/b14-8+/t10-,16+,18-,19-,20+/m0/s1 |
| InChI Key | NCJSAZKFIQOZGZ-QORSFGABSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O9 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15768240 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | -0.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.27% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.83% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.22% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.10% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.21% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.31% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.93% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.97% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.02% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.14% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.31% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.09% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cyrtocymura scorpioides |
| PubChem | 163184524 |
| LOTUS | LTS0085187 |
| wikiData | Q105177238 |