[(3R,4R,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5-acetyloxy-10-[(2S,3R,4S,5S)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] (Z)-2-methylbut-2-enoate
Internal ID | 79968c9b-9011-4d9e-92b1-a71490f57258 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(3R,4R,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5-acetyloxy-10-[(2S,3R,4S,5S)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-4a-(hydroxymethyl)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-3-yl] (Z)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2OC(=O)C)C)C)(C)C)OC6C(C(C(CO6)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)C)O)O)O)C)CO)O |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@@H]([C@@]2([C@@H](C[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)[C@@H]2CC1(C)C)C)OC(=O)C)CO)O |
InChI | InChI=1S/C60H96O25/c1-12-25(2)50(75)85-49-48(74)60(24-63)29(19-55(49,5)6)28-13-14-34-57(9)17-16-35(56(7,8)33(57)15-18-58(34,10)59(28,11)20-36(60)78-27(4)64)82-53-46(40(68)32(23-76-53)81-52-45(73)42(70)38(66)30(21-61)79-52)84-54-47(43(71)39(67)31(22-62)80-54)83-51-44(72)41(69)37(65)26(3)77-51/h12-13,26,29-49,51-54,61-63,65-74H,14-24H2,1-11H3/b25-12-/t26-,29-,30+,31+,32-,33-,34+,35-,36+,37-,38+,39+,40-,41+,42-,43-,44+,45+,46+,47+,48-,49-,51-,52-,53-,54-,57-,58+,59+,60-/m0/s1 |
InChI Key | OXXXHTLYXWXQGH-JXZUIFBBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C60H96O25 |
Molecular Weight | 1217.40 g/mol |
Exact Mass | 1216.62406854 g/mol |
Topological Polar Surface Area (TPSA) | 389.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.12% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.98% | 97.36% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 92.89% | 83.57% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.08% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 90.85% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.43% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.99% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.31% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.97% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.79% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.77% | 91.07% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.57% | 91.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.05% | 92.94% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.93% | 95.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.83% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.33% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.23% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.96% | 93.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.33% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.98% | 99.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.91% | 94.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.31% | 89.67% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.75% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.51% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lysimachia foenum-graecum |
PubChem | 163083923 |
LOTUS | LTS0189097 |
wikiData | Q105203035 |