3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 8fe459bf-acbf-49ea-b6ce-8319ee4b02a5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC5C(C(CO5)(CO)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@H]2[C@H]([C@H]([C@@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)O[C@@H]5[C@H]([C@@](CO5)(CO)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C32H38O19/c1-11-19(36)22(39)24(41)29(47-11)45-8-17-20(37)23(40)25(42)30(50-17)48-14-6-15(35)18-16(7-14)49-26(12-2-4-13(34)5-3-12)27(21(18)38)51-31-28(43)32(44,9-33)10-46-31/h2-7,11,17,19-20,22-25,28-31,33-37,39-44H,8-10H2,1H3/t11-,17-,19-,20+,22+,23+,24+,25-,28+,29+,30+,31+,32-/m0/s1 |
InChI Key | XKDYFRZJOFUFSX-SSHBRRBFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C32H38O19 |
Molecular Weight | 726.60 g/mol |
Exact Mass | 726.20072898 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -2.40 |
There are no found synonyms. |
![2D Structure of 3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 3-[(2R,3S,4S)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/8b444fd0-874f-11ee-b267-296779418351.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.76% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.07% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.46% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 97.44% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.05% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.40% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.04% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.04% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.38% | 99.15% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.42% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.51% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.72% | 97.36% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 88.69% | 96.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.57% | 94.45% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 87.54% | 98.35% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.16% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.27% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.26% | 99.23% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.15% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.84% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.86% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.22% | 90.00% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.63% | 95.53% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.35% | 90.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.19% | 92.94% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.91% | 95.78% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.81% | 100.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.77% | 80.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Silphium perfoliatum |
PubChem | 162844765 |
LOTUS | LTS0201033 |
wikiData | Q105329427 |