[(1R,2R,10R,11S,12R,16R,19S,20R)-4,10,13,19-tetramethyl-3,7,17-trioxo-16-propan-2-yl-6-propan-2-ylidene-20-pentacyclo[10.7.1.01,14.02,11.05,11]icosa-4,13-dienyl] acetate
Internal ID | 579cf67a-9266-47bc-b7c0-74fec3bc899e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
IUPAC Name | [(1R,2R,10R,11S,12R,16R,19S,20R)-4,10,13,19-tetramethyl-3,7,17-trioxo-16-propan-2-yl-6-propan-2-ylidene-20-pentacyclo[10.7.1.01,14.02,11.05,11]icosa-4,13-dienyl] acetate |
SMILES (Canonical) | CC1CCC(=O)C(=C(C)C)C2=C(C(=O)C3C12C4C(C35C(CC(=O)C(CC5=C4C)C(C)C)C)OC(=O)C)C |
SMILES (Isomeric) | C[C@@H]1CCC(=O)C(=C(C)C)C2=C(C(=O)[C@@H]3[C@@]12[C@@H]4[C@H]([C@]35[C@H](CC(=O)[C@H](CC5=C4C)C(C)C)C)OC(=O)C)C |
InChI | InChI=1S/C32H42O5/c1-14(2)21-13-22-18(7)27-30(37-20(9)33)31(22,17(6)12-24(21)35)29-28(36)19(8)26-25(15(3)4)23(34)11-10-16(5)32(26,27)29/h14,16-17,21,27,29-30H,10-13H2,1-9H3/t16-,17+,21-,27+,29+,30-,31+,32+/m1/s1 |
InChI Key | ICOGAJPSDXHOSV-VZDDBMCJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H42O5 |
Molecular Weight | 506.70 g/mol |
Exact Mass | 506.30322444 g/mol |
Topological Polar Surface Area (TPSA) | 77.50 Ų |
XlogP | 4.20 |
There are no found synonyms. |
![2D Structure of [(1R,2R,10R,11S,12R,16R,19S,20R)-4,10,13,19-tetramethyl-3,7,17-trioxo-16-propan-2-yl-6-propan-2-ylidene-20-pentacyclo[10.7.1.01,14.02,11.05,11]icosa-4,13-dienyl] acetate 2D Structure of [(1R,2R,10R,11S,12R,16R,19S,20R)-4,10,13,19-tetramethyl-3,7,17-trioxo-16-propan-2-yl-6-propan-2-ylidene-20-pentacyclo[10.7.1.01,14.02,11.05,11]icosa-4,13-dienyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/8b43f200-8646-11ee-9cfb-65967d30531c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.04% | 98.95% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 97.40% | 97.47% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.95% | 96.38% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.22% | 95.71% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.04% | 97.25% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.82% | 93.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 92.15% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.13% | 91.11% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.86% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.13% | 91.19% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 87.53% | 92.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.03% | 96.77% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.20% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.82% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.25% | 93.03% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.68% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.04% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.66% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.03% | 97.50% |
CHEMBL2535 | P11166 | Glucose transporter | 81.90% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.56% | 85.14% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.51% | 91.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.03% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Xylopia vielana |
PubChem | 163104384 |
LOTUS | LTS0156292 |
wikiData | Q105111097 |