10-hydroxy-10-(7-hydroxy-4-oxo-3,5,6,7-tetrahydro-2H-1-benzofuran-2-yl)-2,6-dimethylundeca-2,6-dienoic acid
| Internal ID | 624c6216-7893-4a7f-a897-95a4f5a66998 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 10-hydroxy-10-(7-hydroxy-4-oxo-3,5,6,7-tetrahydro-2H-1-benzofuran-2-yl)-2,6-dimethylundeca-2,6-dienoic acid |
| SMILES (Canonical) | CC(=CCCC(C)(C1CC2=C(O1)C(CCC2=O)O)O)CCC=C(C)C(=O)O |
| SMILES (Isomeric) | CC(=CCCC(C)(C1CC2=C(O1)C(CCC2=O)O)O)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C21H30O6/c1-13(6-4-8-14(2)20(24)25)7-5-11-21(3,26)18-12-15-16(22)9-10-17(23)19(15)27-18/h7-8,17-18,23,26H,4-6,9-12H2,1-3H3,(H,24,25) |
| InChI Key | QETAPCLLJJFFKU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.20423867 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.15% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.62% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.58% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.75% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.29% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.90% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.17% | 96.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.11% | 93.04% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.63% | 99.17% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.30% | 97.05% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.16% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.86% | 91.19% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.75% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.75% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.85% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.06% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163020739 |
| LOTUS | LTS0127028 |
| wikiData | Q104195745 |