(8aS)-7,8-bis(3,4-dimethoxyphenyl)-1,2,3,5,6,8a-hexahydroindolizine
Internal ID | da3be73a-b50a-484f-ba42-296c2b44cf8e |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | (8aS)-7,8-bis(3,4-dimethoxyphenyl)-1,2,3,5,6,8a-hexahydroindolizine |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C3CCCN3CC2)C4=CC(=C(C=C4)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C([C@@H]3CCCN3CC2)C4=CC(=C(C=C4)OC)OC)OC |
InChI | InChI=1S/C24H29NO4/c1-26-20-9-7-16(14-22(20)28-3)18-11-13-25-12-5-6-19(25)24(18)17-8-10-21(27-2)23(15-17)29-4/h7-10,14-15,19H,5-6,11-13H2,1-4H3/t19-/m0/s1 |
InChI Key | LCKAEOSNDAVOOZ-IBGZPJMESA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H29NO4 |
Molecular Weight | 395.50 g/mol |
Exact Mass | 395.20965841 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5747 | Q92793 | CREB-binding protein | 97.26% | 95.12% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.38% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 96.19% | 98.95% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 95.89% | 88.48% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.95% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.19% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 91.36% | 95.78% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 91.28% | 97.53% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.81% | 99.18% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 88.67% | 91.43% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 88.20% | 89.32% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.29% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.58% | 94.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.23% | 92.38% |
CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 84.01% | 95.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.64% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.63% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.37% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.32% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ficus septica |
PubChem | 162958728 |
LOTUS | LTS0073197 |
wikiData | Q105178175 |