(8aS)-2,2,4,8a-tetramethyl-6-propan-2-yl-8,9-dihydrocyclopenta[g]quinolin-7-one
| Internal ID | a0e4a291-0bfa-453e-96cd-2a2939485ab5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (8aS)-2,2,4,8a-tetramethyl-6-propan-2-yl-8,9-dihydrocyclopenta[g]quinolin-7-one |
| SMILES (Canonical) | CC1=CC(N=C2C1=CC3=C(C(=O)CC3(C2)C)C(C)C)(C)C |
| SMILES (Isomeric) | CC1=CC(N=C2C1=CC3=C(C(=O)C[C@@]3(C2)C)C(C)C)(C)C |
| InChI | InChI=1S/C19H25NO/c1-11(2)17-14-7-13-12(3)8-18(4,5)20-15(13)9-19(14,6)10-16(17)21/h7-8,11H,9-10H2,1-6H3/t19-/m0/s1 |
| InChI Key | ZNCHZFFUPFZQEP-IBGZPJMESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 29.40 Ų |
| XlogP | 2.50 |
| BDBM50008518 |
![2D Structure of (8aS)-2,2,4,8a-tetramethyl-6-propan-2-yl-8,9-dihydrocyclopenta[g]quinolin-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/8as-2248a-tetramethyl-6-propan-2-yl-89-dihydrocyclopentagquinolin-7-one.jpg "2D Structure of (8aS)-2,2,4,8a-tetramethyl-6-propan-2-yl-8,9-dihydrocyclopenta[g]quinolin-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.77% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.52% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.01% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.53% | 94.45% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.97% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.85% | 94.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.23% | 90.24% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.45% | 96.77% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.34% | 93.40% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.12% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.96% | 91.11% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 80.89% | 88.84% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.14% | 86.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.13% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 86302611 |
| LOTUS | LTS0095538 |
| wikiData | Q105379949 |