8alpha-Acetoxyachillin
Internal ID | 92bb3703-6574-4bd5-871e-c2c1de9dea2b |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | [(3R,3aS,4S,9aS,9bR)-3,6,9-trimethyl-2,7-dioxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
SMILES (Canonical) | CC1C2C(CC(=C3C(C2OC1=O)C(=CC3=O)C)C)OC(=O)C |
SMILES (Isomeric) | C[C@@H]1[C@H]2[C@H](CC(=C3[C@@H]([C@H]2OC1=O)C(=CC3=O)C)C)OC(=O)C |
InChI | InChI=1S/C17H20O5/c1-7-5-11(19)13-8(2)6-12(21-10(4)18)15-9(3)17(20)22-16(15)14(7)13/h5,9,12,14-16H,6H2,1-4H3/t9-,12+,14+,15+,16-/m1/s1 |
InChI Key | QONYNSMAVSRIRD-NOGGTJNGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H20O5 |
Molecular Weight | 304.34 g/mol |
Exact Mass | 304.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 1.20 |
CHEMBL2270092 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.41% | 85.14% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.41% | 94.80% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.93% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 88.18% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.10% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.20% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.72% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.77% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.32% | 95.56% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.19% | 93.65% |
CHEMBL4072 | P07858 | Cathepsin B | 80.86% | 93.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Seriphidium leucodes |
PubChem | 76330509 |
LOTUS | LTS0074583 |
wikiData | Q105225021 |