[(2S)-1-[[(2S,5R,8R,11S,12S,15R,18S,21S)-2,8-bis[(2R)-butan-2-yl]-5-[(3-chloro-4-hydroxyphenyl)methyl]-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-1-oxo-3-sulfooxypropan-2-yl] hydrogen sulfate
| Internal ID | 13e24446-8a11-460c-a5a9-95c1c88c7d69 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | [(2S)-1-[[(2S,5R,8R,11S,12S,15R,18S,21S)-2,8-bis[(2R)-butan-2-yl]-5-[(3-chloro-4-hydroxyphenyl)methyl]-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-1-oxo-3-sulfooxypropan-2-yl] hydrogen sulfate |
| SMILES (Canonical) | CCC(C)C1C(=O)OC(C(C(=O)NC(C(=O)NC2CCC(N(C2=O)C(C(=O)N(C(C(=O)N1)CC3=CC(=C(C=C3)O)Cl)C)C(C)CC)O)CCCN=C(N)N)NC(=O)C(COS(=O)(=O)O)OS(=O)(=O)O)C |
| SMILES (Isomeric) | CC[C@@H](C)[C@@H]1C(=O)O[C@H]([C@@H](C(=O)N[C@@H](C(=O)N[C@H]2CC[C@@H](N(C2=O)[C@H](C(=O)N([C@@H](C(=O)N1)CC3=CC(=C(C=C3)O)Cl)C)[C@H](C)CC)O)CCCN=C(N)N)NC(=O)[C@H](COS(=O)(=O)O)OS(=O)(=O)O)C |
| InChI | InChI=1S/C40H62ClN9O18S2/c1-7-19(3)30-39(59)67-21(5)31(48-35(55)28(68-70(63,64)65)18-66-69(60,61)62)36(56)45-24(10-9-15-44-40(42)43)33(53)46-25-12-14-29(52)50(37(25)57)32(20(4)8-2)38(58)49(6)26(34(54)47-30)17-22-11-13-27(51)23(41)16-22/h11,13,16,19-21,24-26,28-32,51-52H,7-10,12,14-15,17-18H2,1-6H3,(H,45,56)(H,46,53)(H,47,54)(H,48,55)(H4,42,43,44)(H,60,61,62)(H,63,64,65)/t19-,20-,21+,24-,25+,26-,28+,29+,30-,31+,32+/m1/s1 |
| InChI Key | SBCCONGDAHGETE-LOFUZQJMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H62ClN9O18S2 |
| Molecular Weight | 1056.60 g/mol |
| Exact Mass | 1055.3342762 g/mol |
| Topological Polar Surface Area (TPSA) | 432.00 Ų |
| XlogP | -0.40 |
| Atomic LogP (AlogP) | -2.24 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 17 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6509 | 65.09% |
| Caco-2 | - | 0.8640 | 86.40% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.5033 | 50.33% |
| OATP2B1 inhibitior | - | 0.8573 | 85.73% |
| OATP1B1 inhibitior | + | 0.8146 | 81.46% |
| OATP1B3 inhibitior | + | 0.9340 | 93.40% |
| MATE1 inhibitior | - | 0.6200 | 62.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.7431 | 74.31% |
| P-glycoprotein inhibitior | + | 0.7456 | 74.56% |
| P-glycoprotein substrate | + | 0.8659 | 86.59% |
| CYP3A4 substrate | + | 0.7445 | 74.45% |
| CYP2C9 substrate | - | 0.8002 | 80.02% |
| CYP2D6 substrate | - | 0.8447 | 84.47% |
| CYP3A4 inhibition | - | 0.7786 | 77.86% |
| CYP2C9 inhibition | - | 0.6901 | 69.01% |
| CYP2C19 inhibition | - | 0.6446 | 64.46% |
| CYP2D6 inhibition | - | 0.8383 | 83.83% |
| CYP1A2 inhibition | - | 0.7013 | 70.13% |
| CYP2C8 inhibition | + | 0.7992 | 79.92% |
| CYP inhibitory promiscuity | - | 0.9034 | 90.34% |
| UGT catelyzed | + | 1.0000 | 100.00% |
| Carcinogenicity (binary) | - | 0.5635 | 56.35% |
| Carcinogenicity (trinary) | Non-required | 0.5543 | 55.43% |
| Eye corrosion | - | 0.9759 | 97.59% |
| Eye irritation | - | 0.9019 | 90.19% |
| Skin irritation | - | 0.7566 | 75.66% |
| Skin corrosion | - | 0.9100 | 91.00% |
| Ames mutagenesis | - | 0.5454 | 54.54% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4746 | 47.46% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | + | 0.5375 | 53.75% |
| skin sensitisation | - | 0.8223 | 82.23% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.6875 | 68.75% |
| Nephrotoxicity | - | 0.6841 | 68.41% |
| Acute Oral Toxicity (c) | III | 0.5751 | 57.51% |
| Estrogen receptor binding | + | 0.8251 | 82.51% |
| Androgen receptor binding | + | 0.7248 | 72.48% |
| Thyroid receptor binding | + | 0.6300 | 63.00% |
| Glucocorticoid receptor binding | + | 0.6413 | 64.13% |
| Aromatase binding | + | 0.6489 | 64.89% |
| PPAR gamma | + | 0.7876 | 78.76% |
| Honey bee toxicity | - | 0.6773 | 67.73% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.5248 | 52.48% |
| Fish aquatic toxicity | + | 0.9114 | 91.14% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.60% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.48% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 98.59% | 96.38% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 98.56% | 95.93% |
| CHEMBL4072 | P07858 | Cathepsin B | 98.35% | 93.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 96.05% | 93.03% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.89% | 96.61% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 95.85% | 95.34% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.52% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.44% | 95.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.05% | 98.59% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 94.13% | 96.76% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.13% | 92.88% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.33% | 96.31% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.30% | 91.03% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.24% | 94.66% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.73% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.44% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.69% | 83.82% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 88.31% | 80.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.87% | 86.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.87% | 96.90% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.43% | 98.05% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.43% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.32% | 94.73% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.15% | 98.57% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.11% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.53% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.47% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.78% | 99.15% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 84.27% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.15% | 97.25% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.01% | 90.24% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.97% | 86.92% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.31% | 95.50% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.18% | 96.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.52% | 93.56% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 82.36% | 88.33% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.17% | 92.29% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.11% | 89.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.07% | 97.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.40% | 90.08% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.98% | 90.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.61% | 92.32% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.21% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162914517 |
| LOTUS | LTS0270183 |
| wikiData | Q105249310 |