[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-[(1R,2S,6R)-6-(2,4-dihydroxyphenyl)-2-[4-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2,6-dihydroxyphenyl]-4-methylcyclohex-3-en-1-yl]methanone
Internal ID | 8f89afab-9706-4a0b-9a65-5950f0021525 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | [2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-[(1R,2S,6R)-6-(2,4-dihydroxyphenyl)-2-[4-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2,6-dihydroxyphenyl]-4-methylcyclohex-3-en-1-yl]methanone |
SMILES (Canonical) | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C(=C(C=C3)O)CC=C(C)C)O)C4=C(C=C(C=C4O)C=CC5=C(C=C(C=C5)O)O)O |
SMILES (Isomeric) | CC1=C[C@@H]([C@@H]([C@@H](C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C(=C(C=C3)O)CC=C(C)C)O)C4=C(C=C(C=C4O)/C=C/C5=C(C=C(C=C5)O)O)O |
InChI | InChI=1S/C39H38O9/c1-20(2)4-10-27-31(42)13-12-28(38(27)47)39(48)36-29(26-11-9-25(41)19-33(26)44)14-21(3)15-30(36)37-34(45)16-22(17-35(37)46)5-6-23-7-8-24(40)18-32(23)43/h4-9,11-13,15-19,29-30,36,40-47H,10,14H2,1-3H3/b6-5+/t29-,30-,36+/m0/s1 |
InChI Key | HGFWVFTZYRJFRI-DRPISQTGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H38O9 |
Molecular Weight | 650.70 g/mol |
Exact Mass | 650.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 179.00 Ų |
XlogP | 7.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.59% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.57% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.96% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.83% | 95.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.16% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.55% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.99% | 86.33% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 89.62% | 91.38% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.53% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.43% | 97.36% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.37% | 95.58% |
CHEMBL3194 | P02766 | Transthyretin | 85.91% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.89% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.72% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.72% | 100.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.56% | 97.21% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.31% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.76% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.38% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.21% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.12% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.93% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.33% | 96.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.03% | 95.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sorocea bonplandii |
PubChem | 163186425 |
LOTUS | LTS0083924 |
wikiData | Q105027720 |