[6-[2-(1,3-Benzodioxol-5-yl)ethenyl]-4-pentyl-5-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone
Internal ID | 75a543e1-c162-4e19-8671-eb14985e4ec3 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | [6-[2-(1,3-benzodioxol-5-yl)ethenyl]-4-pentyl-5-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone |
SMILES (Canonical) | CCCCCC1C=CC(C(C1C(=O)N2CCCCC2)C=CC3=CC4=C(C=C3)OCO4)C(=O)N5CCCCC5 |
SMILES (Isomeric) | CCCCCC1C=CC(C(C1C(=O)N2CCCCC2)C=CC3=CC4=C(C=C3)OCO4)C(=O)N5CCCCC5 |
InChI | InChI=1S/C32H44N2O4/c1-2-3-6-11-25-14-16-27(31(35)33-18-7-4-8-19-33)26(30(25)32(36)34-20-9-5-10-21-34)15-12-24-13-17-28-29(22-24)38-23-37-28/h12-17,22,25-27,30H,2-11,18-21,23H2,1H3 |
InChI Key | VNOOPTBSKLNJEH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H44N2O4 |
Molecular Weight | 520.70 g/mol |
Exact Mass | 520.33010789 g/mol |
Topological Polar Surface Area (TPSA) | 59.10 Ų |
XlogP | 6.40 |
There are no found synonyms. |
![2D Structure of [6-[2-(1,3-Benzodioxol-5-yl)ethenyl]-4-pentyl-5-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone 2D Structure of [6-[2-(1,3-Benzodioxol-5-yl)ethenyl]-4-pentyl-5-(piperidine-1-carbonyl)cyclohex-2-en-1-yl]-piperidin-1-ylmethanone](https://plantaedb.com/storage/docs/compounds/2023/11/8a1ba660-85f9-11ee-9af4-77f7e95eca39.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.16% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 98.44% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.99% | 96.09% |
CHEMBL240 | Q12809 | HERG | 95.46% | 89.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.44% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.48% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.20% | 96.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 90.53% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.02% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.99% | 94.80% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.66% | 91.81% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.11% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.03% | 97.25% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.80% | 90.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.22% | 96.77% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.06% | 95.50% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.79% | 98.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.64% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.32% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.92% | 97.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.80% | 92.62% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.38% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.91% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.81% | 99.17% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.41% | 96.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.18% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.05% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 73085886 |
LOTUS | LTS0108020 |
wikiData | Q105289813 |