2-hydroxy-1-[(4R,12S,13R,14S,16R,17S,18S,20S)-14-hydroxy-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone
| Internal ID | 774e2a51-4b65-4cbd-ae93-e521e66f29ec |
| Taxonomy | Alkaloids and derivatives > Strychnos alkaloids |
| IUPAC Name | 2-hydroxy-1-[(4R,12S,13R,14S,16R,17S,18S,20S)-14-hydroxy-16-methyl-15-oxa-1,11-diazahexacyclo[15.3.1.04,12.04,20.05,10.013,18]henicosa-5,7,9-trien-11-yl]ethanone |
| SMILES (Canonical) | CC1C2CN3CCC45C3CC2C(C4N(C6=CC=CC=C56)C(=O)CO)C(O1)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2CN3CC[C@@]45[C@@H]3C[C@@H]2[C@H]([C@@H]4N(C6=CC=CC=C56)C(=O)CO)[C@H](O1)O |
| InChI | InChI=1S/C21H26N2O4/c1-11-13-9-22-7-6-21-14-4-2-3-5-15(14)23(17(25)10-24)19(21)18(20(26)27-11)12(13)8-16(21)22/h2-5,11-13,16,18-20,24,26H,6-10H2,1H3/t11-,12+,13+,16+,18-,19+,20+,21-/m1/s1 |
| InChI Key | DCCKZUSAIKUCMB-CZCWFSCQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.18925731 g/mol |
| Topological Polar Surface Area (TPSA) | 73.20 Ų |
| XlogP | 1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.17% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.75% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.45% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.19% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.84% | 90.17% |
| CHEMBL5028 | O14672 | ADAM10 | 86.70% | 97.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.02% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.17% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.29% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.93% | 100.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.46% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos henningsii |
| PubChem | 163041491 |
| LOTUS | LTS0085239 |
| wikiData | Q104975193 |