[16-Acetyloxy-8,9,11-trihydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-2-phenylmethoxy-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-5-yl] acetate
| Internal ID | fe073771-0ff9-4793-8399-e21aa03264fd |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
| IUPAC Name | [16-acetyloxy-8,9,11-trihydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-2-phenylmethoxy-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-5-yl] acetate |
| SMILES (Canonical) | CC1=C2C(C(C3(C(CC4C(C3C(C2(CC1OC(=O)C)C(C)(C)O)OCC5=CC=CC=C5)(CO4)OC(=O)C)O)C)O)O |
| SMILES (Isomeric) | CC1=C2C(C(C3(C(CC4C(C3C(C2(CC1OC(=O)C)C(C)(C)O)OCC5=CC=CC=C5)(CO4)OC(=O)C)O)C)O)O |
| InChI | InChI=1S/C31H42O10/c1-16-20(40-17(2)32)13-30(28(4,5)37)23(16)24(35)26(36)29(6)21(34)12-22-31(15-39-22,41-18(3)33)25(29)27(30)38-14-19-10-8-7-9-11-19/h7-11,20-22,24-27,34-37H,12-15H2,1-6H3 |
| InChI Key | JAIXJBRZCLXJJI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H42O10 |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.27779753 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
![2D Structure of [16-Acetyloxy-8,9,11-trihydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-2-phenylmethoxy-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-5-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/8a0b5520-8691-11ee-9d41-c9122799b5c9.jpg "2D Structure of [16-Acetyloxy-8,9,11-trihydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-2-phenylmethoxy-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-5-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.29% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.38% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.84% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.40% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.21% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.50% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.95% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.81% | 97.14% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.82% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.48% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.38% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.31% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.15% | 89.44% |
| CHEMBL5028 | O14672 | ADAM10 | 85.01% | 97.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.86% | 95.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.51% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.93% | 97.25% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.57% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus baccata |
| PubChem | 162844546 |
| LOTUS | LTS0180636 |
| wikiData | Q105123781 |