4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picene-3,8,9-triol
Internal ID | 457a1048-6d52-416b-a56a-35548299ff11 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picene-3,8,9-triol |
SMILES (Canonical) | CC1C2C3CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C=C1C)O)C)O)C)C)(C)C)O)C |
SMILES (Isomeric) | CC1C2C3CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C=C1C)O)C)O)C)C)(C)C)O)C |
InChI | InChI=1S/C30H50O3/c1-17-15-23(32)30(8)24(33)16-29(7)19(25(30)18(17)2)9-10-21-27(5)13-12-22(31)26(3,4)20(27)11-14-28(21,29)6/h15,18-25,31-33H,9-14,16H2,1-8H3 |
InChI Key | SCAPWGHHHZEERU-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H50O3 |
Molecular Weight | 458.70 g/mol |
Exact Mass | 458.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 6.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.20% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.96% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.12% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.88% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.92% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.30% | 94.75% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.00% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 85.04% | 98.95% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.90% | 95.58% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.33% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.88% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.02% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calendula officinalis |
Chrysanthemum morifolium |
Hunteria zeylanica |
PubChem | 74344353 |
LOTUS | LTS0158112 |
wikiData | Q104403717 |