8a-Methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene
| Internal ID | ee5427f0-6367-4081-8c6c-2500c82d0ee3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | 8a-methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES (Canonical) | CC(C)C1CCC2(CCCC(=C)C2C1)C |
| SMILES (Isomeric) | CC(C)C1CCC2(CCCC(=C)C2C1)C |
| InChI | InChI=1S/C15H26/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h11,13-14H,3,5-10H2,1-2,4H3 |
| InChI Key | IEICDHBPEPUHOB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.203450829 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.48% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.17% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.20% | 97.79% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.08% | 97.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.01% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.95% | 96.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.94% | 95.58% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.76% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.36% | 82.69% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.63% | 96.38% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.24% | 98.10% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.65% | 99.18% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.47% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.82% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.15% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.65% | 91.11% |
| CHEMBL238 | Q01959 | Dopamine transporter | 81.17% | 95.88% |
| CHEMBL3920 | Q04759 | Protein kinase C theta | 80.18% | 97.69% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.13% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abies firma |
| Callilepis salicifolia |
| Lophocolea heterophylla |
| Mikania alvimii |
| Tessaria integrifolia |
| PubChem | 85348873 |
| LOTUS | LTS0141441 |
| wikiData | Q105111779 |