3-Ethoxy-5-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-6,13-diol
Internal ID | 3bf065e6-3bc6-45bd-b3f9-8ab70bdf4067 |
Taxonomy | Benzenoids > Phenanthrenes and derivatives |
IUPAC Name | 3-ethoxy-5-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-6,13-diol |
SMILES (Canonical) | CCOC1C2=C3C(=CC(=C2OC)O)CCC4=C3C(=CC(=C4)O)O1 |
SMILES (Isomeric) | CCOC1C2=C3C(=CC(=C2OC)O)CCC4=C3C(=CC(=C4)O)O1 |
InChI | InChI=1S/C18H18O5/c1-3-22-18-16-15-10(7-12(20)17(16)21-2)5-4-9-6-11(19)8-13(23-18)14(9)15/h6-8,18-20H,3-5H2,1-2H3 |
InChI Key | MOJAVWXBRQURQV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H18O5 |
Molecular Weight | 314.30 g/mol |
Exact Mass | 314.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of 3-Ethoxy-5-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-6,13-diol 2D Structure of 3-Ethoxy-5-methoxy-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-6,13-diol](https://plantaedb.com/storage/docs/compounds/2023/11/89f51300-85ba-11ee-8dd3-157437925d66.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.45% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.60% | 94.45% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.80% | 91.79% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.68% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.14% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.96% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.43% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.54% | 94.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.26% | 82.67% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.13% | 92.68% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.98% | 92.94% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.84% | 96.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.48% | 94.73% |
CHEMBL236 | P41143 | Delta opioid receptor | 81.77% | 99.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Agrostophyllum callosum |
PubChem | 101995816 |
LOTUS | LTS0140066 |
wikiData | Q105168932 |