(2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | 1d56082e-68ed-439e-b5cb-4bfc6265b2ca |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)OC)O)O)OC6C(C(C(C(O6)C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)OC)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H40O21/c1-10-21(38)23(40)27(44)32(50-10)49-9-19-22(39)25(42)30(55-33-28(45)24(41)26(43)29(54-33)31(46)47)34(53-19)51-12-6-14(36)20-15(37)8-17(52-18(20)7-12)11-3-4-16(48-2)13(35)5-11/h3-8,10,19,21-30,32-36,38-45H,9H2,1-2H3,(H,46,47)/t10-,19+,21-,22+,23+,24-,25-,26-,27+,28+,29-,30+,32+,33-,34+/m0/s1 |
InChI Key | SLECFTJJACJAJE-ZGWOCCEWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H40O21 |
Molecular Weight | 784.70 g/mol |
Exact Mass | 784.20620828 g/mol |
Topological Polar Surface Area (TPSA) | 331.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid 2D Structure of (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-2-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/89d855f0-87ae-11ee-a257-43d3304863ff.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.69% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.31% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.21% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.10% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.56% | 85.14% |
CHEMBL3194 | P02766 | Transthyretin | 94.79% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.21% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.29% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.55% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.98% | 96.09% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.62% | 81.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.59% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.40% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.30% | 95.78% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.85% | 83.57% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.70% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.75% | 95.89% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 82.38% | 87.67% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.96% | 86.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.53% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.25% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.09% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.99% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.45% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Robinia pseudoacacia |
PubChem | 101497868 |
LOTUS | LTS0059289 |
wikiData | Q105255234 |