[(2R,3R,4S,5R,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]-2-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
| Internal ID | 2d7d0770-d416-4a3f-a8b7-bbd6677c7a8d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid 3p-O-p-coumaroyl glycosides |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[5-[5,7-dihydroxy-4-oxo-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]-2-[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)/C=C/C(=O)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)OC3=C(C=CC(=C3)C4=C(C(=O)C5=C(C=C(C=C5O4)O)O)O[C@H]6[C@H]([C@@H]([C@@H]([C@H](O6)CO)O)O)O)O[C@@H]7[C@H]([C@H]([C@H]([C@H](O7)CO)O)O)O)O)O)O |
| InChI | InChI=1S/C44H50O26/c1-61-22-7-15(8-23(62-2)29(22)50)3-6-27(49)63-14-26-32(53)36(57)38(59)43(69-26)66-20-9-16(4-5-19(20)65-42-37(58)34(55)30(51)24(12-45)67-42)40-41(33(54)28-18(48)10-17(47)11-21(28)64-40)70-44-39(60)35(56)31(52)25(13-46)68-44/h3-11,24-26,30-32,34-39,42-48,50-53,55-60H,12-14H2,1-2H3/b6-3+/t24-,25-,26-,30+,31-,32+,34+,35-,36+,37+,38-,39+,42+,43-,44+/m1/s1 |
| InChI Key | HYKYULCYPDZJEV-VZIAKPPLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H50O26 |
| Molecular Weight | 994.80 g/mol |
| Exact Mass | 994.25903170 g/mol |
| Topological Polar Surface Area (TPSA) | 410.00 Ų |
| XlogP | -1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.76% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.84% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.19% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.66% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 95.25% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.12% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.49% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.77% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.32% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.73% | 86.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.30% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.11% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.87% | 91.49% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.85% | 95.64% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 88.29% | 98.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.69% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.55% | 94.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.86% | 94.33% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.30% | 95.78% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.45% | 97.33% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.25% | 95.53% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.06% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163190962 |
| LOTUS | LTS0210330 |
| wikiData | Q105035366 |