[(1S)-1-[(1S,4R,5R,6R,8R,10R,11R,12S,13R,16R,18S,21R)-10,11-dihydroxy-4,6,12,17,17-pentamethyl-18-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate
Internal ID | 20597fe2-3078-4713-8633-dc3f896bbcd2 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(1S)-1-[(1S,4R,5R,6R,8R,10R,11R,12S,13R,16R,18S,21R)-10,11-dihydroxy-4,6,12,17,17-pentamethyl-18-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate |
SMILES (Canonical) | CC1CC(OC2(C1C3(CCC45CC46CCC(C(C6CCC5C3(C2O)C)(C)C)OC7C(C(C(CO7)O)O)O)C)O)C(C(C)(C)O)OC(=O)C |
SMILES (Isomeric) | C[C@@H]1C[C@@H](O[C@@]2([C@H]1[C@]3(CC[C@@]45C[C@@]46CC[C@@H](C([C@@H]6CC[C@H]5[C@@]3([C@H]2O)C)(C)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)C)O)[C@@H](C(C)(C)O)OC(=O)C |
InChI | InChI=1S/C37H60O11/c1-18-15-21(28(32(5,6)43)46-19(2)38)48-37(44)27(18)33(7)13-14-36-17-35(36)12-11-24(47-29-26(41)25(40)20(39)16-45-29)31(3,4)22(35)9-10-23(36)34(33,8)30(37)42/h18,20-30,39-44H,9-17H2,1-8H3/t18-,20-,21-,22+,23+,24+,25+,26-,27-,28+,29+,30-,33-,34-,35-,36+,37-/m1/s1 |
InChI Key | PJGMIZSCETWMLA-USIWENNYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H60O11 |
Molecular Weight | 680.90 g/mol |
Exact Mass | 680.41356273 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 2.65 |
H-Bond Acceptor | 11 |
H-Bond Donor | 6 |
Rotatable Bonds | 5 |
There are no found synonyms. |
![2D Structure of [(1S)-1-[(1S,4R,5R,6R,8R,10R,11R,12S,13R,16R,18S,21R)-10,11-dihydroxy-4,6,12,17,17-pentamethyl-18-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate 2D Structure of [(1S)-1-[(1S,4R,5R,6R,8R,10R,11R,12S,13R,16R,18S,21R)-10,11-dihydroxy-4,6,12,17,17-pentamethyl-18-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/893a18d0-8760-11ee-8d5a-7133442876ed.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7645 | 76.45% |
Caco-2 | - | 0.8616 | 86.16% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.7286 | 72.86% |
Subcellular localzation | Mitochondria | 0.7323 | 73.23% |
OATP2B1 inhibitior | - | 0.7332 | 73.32% |
OATP1B1 inhibitior | + | 0.8543 | 85.43% |
OATP1B3 inhibitior | + | 0.9168 | 91.68% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8000 | 80.00% |
BSEP inhibitior | - | 0.7866 | 78.66% |
P-glycoprotein inhibitior | + | 0.7691 | 76.91% |
P-glycoprotein substrate | + | 0.6212 | 62.12% |
CYP3A4 substrate | + | 0.7303 | 73.03% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8759 | 87.59% |
CYP3A4 inhibition | - | 0.9010 | 90.10% |
CYP2C9 inhibition | - | 0.8004 | 80.04% |
CYP2C19 inhibition | - | 0.8732 | 87.32% |
CYP2D6 inhibition | - | 0.9501 | 95.01% |
CYP1A2 inhibition | - | 0.8400 | 84.00% |
CYP2C8 inhibition | + | 0.7305 | 73.05% |
CYP inhibitory promiscuity | - | 0.9767 | 97.67% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6815 | 68.15% |
Eye corrosion | - | 0.9898 | 98.98% |
Eye irritation | - | 0.9134 | 91.34% |
Skin irritation | - | 0.6513 | 65.13% |
Skin corrosion | - | 0.9378 | 93.78% |
Ames mutagenesis | - | 0.5300 | 53.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6824 | 68.24% |
Micronuclear | - | 0.7900 | 79.00% |
Hepatotoxicity | - | 0.6716 | 67.16% |
skin sensitisation | - | 0.8913 | 89.13% |
Respiratory toxicity | - | 0.5111 | 51.11% |
Reproductive toxicity | + | 0.7778 | 77.78% |
Mitochondrial toxicity | + | 0.6875 | 68.75% |
Nephrotoxicity | - | 0.7113 | 71.13% |
Acute Oral Toxicity (c) | III | 0.3650 | 36.50% |
Estrogen receptor binding | + | 0.5506 | 55.06% |
Androgen receptor binding | + | 0.7231 | 72.31% |
Thyroid receptor binding | - | 0.5614 | 56.14% |
Glucocorticoid receptor binding | + | 0.6318 | 63.18% |
Aromatase binding | + | 0.7000 | 70.00% |
PPAR gamma | + | 0.6511 | 65.11% |
Honey bee toxicity | - | 0.6418 | 64.18% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
Fish aquatic toxicity | + | 0.9260 | 92.60% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2409 | P34913 | Epoxide hydratase |
400 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.46% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 96.15% | 98.75% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.94% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.35% | 89.34% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.99% | 82.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.00% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.73% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.51% | 92.88% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.37% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.13% | 85.14% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.11% | 95.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.23% | 97.09% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.08% | 100.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.94% | 89.50% |
CHEMBL3837 | P07711 | Cathepsin L | 89.84% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.37% | 89.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 88.46% | 95.69% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.12% | 92.86% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.50% | 95.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.97% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.51% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.26% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.29% | 91.07% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.96% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.87% | 92.94% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.81% | 97.28% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.80% | 94.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.19% | 97.79% |
CHEMBL5028 | O14672 | ADAM10 | 82.08% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.94% | 95.93% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.59% | 91.03% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.51% | 82.50% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.48% | 97.05% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.07% | 92.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.82% | 97.21% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.70% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Actaea pachypoda |
Actaea yunnanensis |
PubChem | 58901565 |
LOTUS | LTS0082903 |
wikiData | Q105209942 |