[(1S,3S,13S,14R,17S,19R,20R,21S,22R,23R,24R,25S)-18,21,22-triacetyloxy-20-(acetyloxymethyl)-24,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate
Internal ID | e9f7e1a3-b98b-4460-b7f8-ade68a0ae39f |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | [(1S,3S,13S,14R,17S,19R,20R,21S,22R,23R,24R,25S)-18,21,22-triacetyloxy-20-(acetyloxymethyl)-24,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate |
SMILES (Canonical) | CC1C(C(=O)OC2C(C(C3(C(C(C4C(C3(C2(C)O)OC4(COC(=O)C5=C1N=CC=C5)C)O)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C6=CC=CC=C6)OC(=O)C)C |
SMILES (Isomeric) | C[C@H]1[C@H](C(=O)O[C@H]2C([C@@H]([C@]3([C@@H]([C@@H]([C@H]4[C@H]([C@@]3([C@@]2(C)O)O[C@@]4(COC(=O)C5=C1N=CC=C5)C)O)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C6=CC=CC=C6)OC(=O)C)C |
InChI | InChI=1S/C41H47NO17/c1-19-20(2)35(48)57-32-30(55-23(5)45)34(58-36(49)25-13-10-9-11-14-25)40(18-52-21(3)43)33(56-24(6)46)29(54-22(4)44)27-31(47)41(40,39(32,8)51)59-38(27,7)17-53-37(50)26-15-12-16-42-28(19)26/h9-16,19-20,27,29-34,47,51H,17-18H2,1-8H3/t19-,20+,27-,29+,30?,31+,32-,33+,34-,38+,39-,40+,41-/m0/s1 |
InChI Key | CYMKPLHGMJGZSE-STRWIKJKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H47NO17 |
Molecular Weight | 825.80 g/mol |
Exact Mass | 825.28439903 g/mol |
Topological Polar Surface Area (TPSA) | 247.00 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of [(1S,3S,13S,14R,17S,19R,20R,21S,22R,23R,24R,25S)-18,21,22-triacetyloxy-20-(acetyloxymethyl)-24,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate 2D Structure of [(1S,3S,13S,14R,17S,19R,20R,21S,22R,23R,24R,25S)-18,21,22-triacetyloxy-20-(acetyloxymethyl)-24,25-dihydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/88e60550-8705-11ee-8123-c10098770587.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.55% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.21% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.12% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.50% | 96.09% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.83% | 81.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.47% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.74% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.17% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.53% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.51% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.28% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.20% | 94.00% |
CHEMBL5028 | O14672 | ADAM10 | 85.08% | 97.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.35% | 83.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.13% | 94.42% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.18% | 93.10% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.87% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.18% | 94.73% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.00% | 96.67% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.79% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.73% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.71% | 95.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.52% | 94.62% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.44% | 87.67% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.43% | 91.07% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.34% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.24% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.20% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euonymus japonicus |
PubChem | 102056155 |
LOTUS | LTS0074009 |
wikiData | Q104972419 |