[(1R,2R,3S,8R,10R,11R,15S,16S,17S)-3,17-diacetyloxy-15-(furan-3-yl)-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] (E)-2-methylbut-2-enoate
| Internal ID | c2e815fe-0e5e-4345-a9cf-56d978fcf707 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [(1R,2R,3S,8R,10R,11R,15S,16S,17S)-3,17-diacetyloxy-15-(furan-3-yl)-2,7,7,11,16-pentamethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-10-yl] (E)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1CC2C(OC(=O)CC(C2(C3C1(C4=CCC(C4(C(C3)OC(=O)C)C)C5=COC=C5)C)C)OC(=O)C)(C)C |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1C[C@@H]2[C@@]([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4([C@H](C3)OC(=O)C)C)C5=COC=C5)C)([C@H](CC(=O)OC2(C)C)OC(=O)C)C |
| InChI | InChI=1S/C35H46O9/c1-10-19(2)31(39)43-28-15-25-32(5,6)44-30(38)17-29(42-21(4)37)35(25,9)26-16-27(41-20(3)36)33(7)23(22-13-14-40-18-22)11-12-24(33)34(26,28)8/h10,12-14,18,23,25-29H,11,15-17H2,1-9H3/b19-10+/t23-,25-,26-,27-,28+,29-,33-,34-,35-/m0/s1 |
| InChI Key | SDLJCDUICZWSDZ-RKZWBVLESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H46O9 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.31418304 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.99% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.88% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.47% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.60% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.54% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.20% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.15% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.93% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.62% | 99.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.66% | 91.19% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.89% | 94.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.52% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.21% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.42% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.11% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trichilia rubra |
| PubChem | 10348771 |
| LOTUS | LTS0213405 |
| wikiData | Q105250722 |