methyl 2-[3-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-7-methylidene-5-(3-methylpent-2-enoyloxy)-2-oxo-3,3a,4,5,6,7a-hexahydro-1H-inden-4-yl]oxirane-2-carboxylate
| Internal ID | e2408736-773c-48c7-bfdd-8b3c979f5638 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | methyl 2-[3-(1-acetyloxyethyl)-6-(2-methylbutanoyloxy)-7-methylidene-5-(3-methylpent-2-enoyloxy)-2-oxo-3,3a,4,5,6,7a-hexahydro-1H-inden-4-yl]oxirane-2-carboxylate |
| SMILES (Canonical) | CCC(C)C(=O)OC1C(C(C2C(C1=C)CC(=O)C2C(C)OC(=O)C)C3(CO3)C(=O)OC)OC(=O)C=C(C)CC |
| SMILES (Isomeric) | CCC(C)C(=O)OC1C(C(C2C(C1=C)CC(=O)C2C(C)OC(=O)C)C3(CO3)C(=O)OC)OC(=O)C=C(C)CC |
| InChI | InChI=1S/C29H40O10/c1-9-14(3)11-21(32)38-26-24(29(13-36-29)28(34)35-8)23-19(12-20(31)22(23)17(6)37-18(7)30)16(5)25(26)39-27(33)15(4)10-2/h11,15,17,19,22-26H,5,9-10,12-13H2,1-4,6-8H3 |
| InChI Key | YTHVZZMZWKVZHI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.26214747 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.19% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.51% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.46% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 96.03% | 89.34% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.23% | 85.14% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.58% | 95.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.31% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.61% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.16% | 83.82% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.83% | 92.88% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.44% | 96.47% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.35% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.97% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.27% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.16% | 96.77% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.06% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.72% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.70% | 94.80% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.62% | 95.71% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.56% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.24% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.15% | 97.21% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.48% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.88% | 96.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.43% | 97.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.92% | 89.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.85% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.84% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.64% | 97.25% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.39% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caputia tomentosa |
| PubChem | 162979698 |
| LOTUS | LTS0133121 |
| wikiData | Q105361453 |