8,8-Dimethyl-4-methylidene-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]octane-3-carbaldehyde
| Internal ID | 5ceea972-a8aa-4fb3-bfa9-8d5b772e5d6f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Aromadendrane sesquiterpenoids |
| IUPAC Name | 8,8-dimethyl-4-methylidene-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]octane-3-carbaldehyde |
| SMILES (Canonical) | CC1(C2C1C(C(C(=C)CC2)C=O)C(=C)C=O)C |
| SMILES (Isomeric) | CC1(C2C1C(C(C(=C)CC2)C=O)C(=C)C=O)C |
| InChI | InChI=1S/C15H20O2/c1-9-5-6-12-14(15(12,3)4)13(10(2)7-16)11(9)8-17/h7-8,11-14H,1-2,5-6H2,3-4H3 |
| InChI Key | IJHRWJBWXDIJJH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 8,8-Dimethyl-4-methylidene-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]octane-3-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/88-dimethyl-4-methylidene-2-3-oxoprop-1-en-2-ylbicyclo510octane-3-carbaldehyde.jpg "2D Structure of 8,8-Dimethyl-4-methylidene-2-(3-oxoprop-1-en-2-yl)bicyclo[5.1.0]octane-3-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.43% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 90.27% | 96.43% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.93% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.97% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.94% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.73% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.57% | 91.19% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.04% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plagiochila semidecurrens |
| PubChem | 163032038 |
| LOTUS | LTS0137777 |
| wikiData | Q105113954 |