[6-[5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]oxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 7aa65e7f-2d77-4012-a2a1-09c3dd7e48f5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]oxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C39H32O15/c40-23-9-1-20(2-10-23)5-15-30(45)50-19-29-33(47)35(49)38(53-31(46)16-6-21-3-11-24(41)12-4-21)39(52-29)54-37-34(48)32-27(44)17-26(43)18-28(32)51-36(37)22-7-13-25(42)14-8-22/h1-18,29,33,35,38-44,47,49H,19H2 |
InChI Key | YXXQUJGFZPLXJV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H32O15 |
Molecular Weight | 740.70 g/mol |
Exact Mass | 740.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 239.00 Ų |
XlogP | 4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3729 | P22748 | Carbonic anhydrase IV |
344.2 nM |
Ki |
via Super-PRED
|
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
4.7 nM |
Ki |
via Super-PRED
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
408.9 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 98.79% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.47% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.70% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 96.88% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.92% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.69% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.17% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.01% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.58% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.61% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.32% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.27% | 97.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.25% | 96.12% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.84% | 95.78% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 84.75% | 97.03% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.00% | 95.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.83% | 99.15% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.82% | 80.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.84% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.71% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.63% | 94.00% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.42% | 88.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.41% | 95.89% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.02% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melastoma malabathricum |
Quercus dentata |
Quercus ilex |
Quercus laurifolia |
Quercus robur |
Quercus suber |
PubChem | 74978032 |
LOTUS | LTS0053908 |
wikiData | Q105368283 |