2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]methoxy]chromen-4-one
Internal ID | f5bceff2-5a75-4d42-855a-617fc0bfcd5e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]methoxy]chromen-4-one |
SMILES (Canonical) | C1C(C(C(C(O1)COC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@@H]([C@H]([C@@H](O1)COC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)O)O |
InChI | InChI=1S/C21H20O11/c22-9-4-12(25)16-14(5-9)32-20(8-1-2-10(23)11(24)3-8)21(19(16)29)31-7-15-18(28)17(27)13(26)6-30-15/h1-5,13,15,17-18,22-28H,6-7H2/t13-,15-,17-,18-/m0/s1 |
InChI Key | ALRFYJWUVHBXLV-IKICRFKJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O11 |
Molecular Weight | 448.40 g/mol |
Exact Mass | 448.10056145 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.32% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.47% | 98.95% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.42% | 96.12% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.20% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.57% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.59% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.47% | 91.49% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 90.46% | 95.64% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 90.15% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.80% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.85% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.79% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.75% | 90.71% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 88.16% | 80.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.78% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.74% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 83.52% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.78% | 99.23% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.76% | 92.88% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.61% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.26% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus alba |
PubChem | 162907201 |
LOTUS | LTS0172770 |
wikiData | Q104914301 |