[(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,11-triacetyloxy-6-(acetyloxymethyl)-2-hydroxy-1,15-dimethyl-9-methylidene-14-oxo-8-[(E)-3-phenylprop-2-enoyl]oxy-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl benzoate
Internal ID | 3d5b8df9-61a7-46d3-86a5-5abe4c813117 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,11-triacetyloxy-6-(acetyloxymethyl)-2-hydroxy-1,15-dimethyl-9-methylidene-14-oxo-8-[(E)-3-phenylprop-2-enoyl]oxy-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl benzoate |
SMILES (Canonical) | CC(=O)OCC1CC(C(=C)C2C1(C(C(C3(C4(COC3(C(=O)CC4C2OC(=O)C)C)C)O)OC(=O)C)OC(=O)C)COC(=O)C5=CC=CC=C5)OC(=O)C=CC6=CC=CC=C6 |
SMILES (Isomeric) | CC(=O)OC[C@H]1C[C@@H](C(=C)[C@@H]2[C@@]1([C@H]([C@@H]([C@@]3([C@]4(CO[C@@]3(C(=O)C[C@H]4[C@H]2OC(=O)C)C)C)O)OC(=O)C)OC(=O)C)COC(=O)C5=CC=CC=C5)OC(=O)/C=C/C6=CC=CC=C6 |
InChI | InChI=1S/C45H50O15/c1-25-34(60-36(51)19-18-30-14-10-8-11-15-30)20-32(22-54-26(2)46)44(24-55-41(52)31-16-12-9-13-17-31)37(25)38(57-27(3)47)33-21-35(50)43(7)45(53,42(33,6)23-56-43)40(59-29(5)49)39(44)58-28(4)48/h8-19,32-34,37-40,53H,1,20-24H2,2-7H3/b19-18+/t32-,33+,34+,37+,38-,39+,40+,42+,43-,44-,45+/m1/s1 |
InChI Key | CTBHVVWTNUDQQI-POPSNBQZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H50O15 |
Molecular Weight | 830.90 g/mol |
Exact Mass | 830.31497088 g/mol |
Topological Polar Surface Area (TPSA) | 204.00 Ų |
XlogP | 3.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.57% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.99% | 86.33% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.85% | 89.34% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.42% | 91.49% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 94.16% | 97.79% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.70% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.32% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.82% | 99.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.81% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.24% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 89.93% | 97.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.71% | 93.99% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.36% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.93% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.25% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.96% | 96.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.13% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.56% | 99.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.75% | 83.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.40% | 81.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.09% | 95.93% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.29% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 163185144 |
LOTUS | LTS0079863 |
wikiData | Q104969694 |