[(5S,7S)-4-(acetyloxymethyl)-7-hydroxy-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-yl] propanoate
| Internal ID | 4c78558d-dd7c-46f9-af34-9dc6fb087c1a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | [(5S,7S)-4-(acetyloxymethyl)-7-hydroxy-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-yl] propanoate |
| SMILES (Canonical) | CCC(=O)OC1=C2C(=C(C3=C1CC(CC3C)O)COC(=O)C)C(=CO2)C |
| SMILES (Isomeric) | CCC(=O)OC1=C2C(=C(C3=C1C[C@H](C[C@@H]3C)O)COC(=O)C)C(=CO2)C |
| InChI | InChI=1S/C20H24O6/c1-5-16(23)26-19-14-7-13(22)6-10(2)17(14)15(9-24-12(4)21)18-11(3)8-25-20(18)19/h8,10,13,22H,5-7,9H2,1-4H3/t10-,13-/m0/s1 |
| InChI Key | CJDTZTGSFJDSGM-GWCFXTLKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 86.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of [(5S,7S)-4-(acetyloxymethyl)-7-hydroxy-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-yl] propanoate](https://plantaedb.com/storage/docs/compounds/2023/11/8787c520-85fd-11ee-82d2-9bb12b33ef36.jpg "2D Structure of [(5S,7S)-4-(acetyloxymethyl)-7-hydroxy-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-yl] propanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.81% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.34% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.17% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.45% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.28% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.18% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.52% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.41% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.98% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.85% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.89% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.13% | 94.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.56% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senecio lydenburgensis |
| PubChem | 162899498 |
| LOTUS | LTS0095587 |
| wikiData | Q104960925 |