(2R,3S,4S,5R,6R)-6-[[(1S,2S,4S,5R,8R,10R,13S,14S,17R,18S,21R,22S,23S)-2,22-diacetyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid
Internal ID | 459596da-8cb9-4933-9542-0735a46ec821 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2R,3S,4S,5R,6R)-6-[[(1S,2S,4S,5R,8R,10R,13S,14S,17R,18S,21R,22S,23S)-2,22-diacetyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C23C(CC1(C)C)C4(CCC5C6(CCC(C(C6CCC5(C4(CC2OC(=O)C)C)C)(C)C)OC7C(C(C(C(O7)C(=O)O)O)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(C(O9)C)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)OC3O)OC(=O)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@H]([C@@]23[C@H](C[C@]4([C@@]5(CC[C@@H]6[C@]([C@@H]5CC[C@]4([C@H]2CC1(C)C)O[C@@H]3O)(CC[C@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](O7)C(=O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@H]([C@H]([C@@H]([C@H](O9)C)O)O)O)O[C@H]1[C@H]([C@H]([C@H]([C@@H](O1)CO)O)O)O)C)C)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C63H98O29/c1-13-24(2)51(79)91-48-49(83-27(5)67)63-32(20-57(48,6)7)62(92-56(63)80)19-15-31-59(10)17-16-33(58(8,9)30(59)14-18-60(31,11)61(62,12)21-34(63)82-26(4)66)86-55-47(90-53-42(75)39(72)36(69)28(22-64)84-53)44(43(76)45(88-55)50(77)78)87-54-46(40(73)37(70)29(23-65)85-54)89-52-41(74)38(71)35(68)25(3)81-52/h13,25,28-49,52-56,64-65,68-76,80H,14-23H2,1-12H3,(H,77,78)/b24-13-/t25-,28+,29-,30+,31+,32-,33-,34+,35-,36+,37-,38+,39+,40+,41+,42+,43+,44+,45-,46-,47-,48+,49-,52+,53+,54+,55-,56+,59-,60-,61+,62-,63+/m1/s1 |
InChI Key | YUIUCMBNDXFYQY-PVMMUFQOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C63H98O29 |
Molecular Weight | 1319.40 g/mol |
Exact Mass | 1318.61937708 g/mol |
Topological Polar Surface Area (TPSA) | 442.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of (2R,3S,4S,5R,6R)-6-[[(1S,2S,4S,5R,8R,10R,13S,14S,17R,18S,21R,22S,23S)-2,22-diacetyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid 2D Structure of (2R,3S,4S,5R,6R)-6-[[(1S,2S,4S,5R,8R,10R,13S,14S,17R,18S,21R,22S,23S)-2,22-diacetyloxy-23-hydroxy-4,5,9,9,13,20,20-heptamethyl-21-[(Z)-2-methylbut-2-enoyl]oxy-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-5-[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/874045a0-86fa-11ee-b16f-534346abf0fe.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.33% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.02% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.28% | 90.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 93.44% | 91.24% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.05% | 97.36% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.98% | 93.00% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 92.07% | 97.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.10% | 86.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.29% | 98.10% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.31% | 92.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.91% | 91.07% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.90% | 91.03% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.49% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.42% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 85.39% | 98.95% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 85.30% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.55% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.03% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.92% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.88% | 99.17% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 83.71% | 95.36% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.45% | 92.98% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.91% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.75% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.55% | 95.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.89% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.87% | 94.75% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.69% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.61% | 97.93% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.45% | 100.00% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.26% | 98.99% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.22% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maesa lanceolata |
PubChem | 162973941 |
LOTUS | LTS0163622 |
wikiData | Q105363016 |