[(1R,3R)-3-[(1S,3R,6S,8R,10S,11R,12S,13R,15R,16R)-10,13-dihydroxy-7,7,12,16-tetramethyl-14-oxo-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-1-[(2S)-3,3-dimethyloxiran-2-yl]butyl] acetate
Internal ID | 72e7cc4f-5e19-4ed8-bd72-5fb1cf0f516b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | [(1R,3R)-3-[(1S,3R,6S,8R,10S,11R,12S,13R,15R,16R)-10,13-dihydroxy-7,7,12,16-tetramethyl-14-oxo-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-1-[(2S)-3,3-dimethyloxiran-2-yl]butyl] acetate |
SMILES (Canonical) | CC(CC(C1C(O1)(C)C)OC(=O)C)C2C(=O)C(C3(C2(CCC45C3C(CC6C4(C5)CCC(C6(C)C)OC7C(C(C(CO7)O)O)O)O)C)C)O |
SMILES (Isomeric) | C[C@H](C[C@H]([C@H]1C(O1)(C)C)OC(=O)C)[C@H]2C(=O)[C@@H]([C@@]3([C@@]2(CC[C@]45[C@H]3[C@H](C[C@@H]6[C@]4(C5)CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)C)C)O |
InChI | InChI=1S/C37H58O11/c1-17(13-21(46-18(2)38)30-33(5,6)48-30)24-26(42)29(44)35(8)28-19(39)14-22-32(3,4)23(47-31-27(43)25(41)20(40)15-45-31)9-10-36(22)16-37(28,36)12-11-34(24,35)7/h17,19-25,27-31,39-41,43-44H,9-16H2,1-8H3/t17-,19+,20-,21-,22+,23+,24+,25+,27-,28+,29+,30+,31+,34-,35-,36-,37+/m1/s1 |
InChI Key | RXFQHRCATQKWNA-RRAUUUAWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H58O11 |
Molecular Weight | 678.80 g/mol |
Exact Mass | 678.39791266 g/mol |
Topological Polar Surface Area (TPSA) | 176.00 Ų |
XlogP | 2.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.95% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.29% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.14% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.65% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.91% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.86% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.60% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.47% | 100.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.39% | 97.28% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.70% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.55% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.06% | 94.75% |
CHEMBL3837 | P07711 | Cathepsin L | 85.60% | 96.61% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.38% | 89.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.17% | 95.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.93% | 94.45% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.84% | 92.88% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.30% | 93.00% |
CHEMBL240 | Q12809 | HERG | 82.01% | 89.76% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.61% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.46% | 93.56% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.31% | 89.34% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.98% | 92.78% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.97% | 95.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.94% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.79% | 82.69% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.68% | 95.71% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.54% | 96.77% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.53% | 94.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.36% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Actaea simplex |
PubChem | 163010237 |
LOTUS | LTS0091861 |
wikiData | Q105246989 |