4-[4,5-Dihydroxy-2-methyl-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl]oxy-5-methylchromen-2-one
Internal ID | b04edcc4-e07d-4175-93fc-e558684efdb9 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 4-[4,5-dihydroxy-2-methyl-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl]oxy-5-methylchromen-2-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)O)O)O)O)O)OC3=CC(=O)OC4=CC=CC(=C43)C |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)O)O)O)O)O)O)OC3=CC(=O)OC4=CC=CC(=C43)C |
InChI | InChI=1S/C22H28O12/c1-8-4-3-5-10-14(8)11(6-13(23)32-10)33-20-9(2)31-22(19(28)17(20)26)30-7-12-15(24)16(25)18(27)21(29)34-12/h3-6,9,12,15-22,24-29H,7H2,1-2H3 |
InChI Key | PTMHNNQOVURLID-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O12 |
Molecular Weight | 484.40 g/mol |
Exact Mass | 484.15807632 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | -1.80 |
There are no found synonyms. |
![2D Structure of 4-[4,5-Dihydroxy-2-methyl-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl]oxy-5-methylchromen-2-one 2D Structure of 4-[4,5-Dihydroxy-2-methyl-6-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]oxan-3-yl]oxy-5-methylchromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/8729aa00-841b-11ee-9ee8-cdc9ab66fbfc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.15% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 97.61% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.68% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.14% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.56% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.85% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.65% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.46% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.75% | 99.23% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.96% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.44% | 96.21% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.32% | 93.65% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.11% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.29% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gerbera jamesonii |
PubChem | 163075311 |
LOTUS | LTS0143724 |
wikiData | Q105214735 |