(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 1c928039-4617-455d-8918-beeca72ca825 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)C)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4([C@@H](C[C@@H](C5)O)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)C)O)O)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)OC |
InChI | InChI=1S/C46H76O18/c1-19(18-58-41-38(55)36(53)34(51)29(17-47)61-41)10-13-46(57-7)20(2)31-28(64-46)16-27-25-9-8-23-14-24(48)15-30(45(23,6)26(25)11-12-44(27,31)5)62-43-40(37(54)33(50)22(4)60-43)63-42-39(56)35(52)32(49)21(3)59-42/h8,19-22,24-43,47-56H,9-18H2,1-7H3/t19-,20-,21-,22+,24+,25+,26-,27-,28-,29+,30+,31-,32-,33-,34+,35+,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,46+/m0/s1 |
InChI Key | WZTHRLVCSDHHTI-NGGLJIRASA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H76O18 |
Molecular Weight | 917.10 g/mol |
Exact Mass | 916.50316557 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-6-methyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/872880d0-84c4-11ee-928e-f7918072dd73.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.42% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.33% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.65% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.36% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.22% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.69% | 93.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.51% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.26% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.04% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 87.10% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.35% | 94.45% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 86.07% | 98.46% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.75% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.96% | 96.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.32% | 96.43% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.19% | 98.05% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.00% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.28% | 94.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.88% | 92.86% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.67% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.19% | 92.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.18% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.04% | 99.17% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.15% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dracaena surculosa |
PubChem | 162991081 |
LOTUS | LTS0175546 |
wikiData | Q105323482 |