6,11-dihydroxy-1-(1-hydroxy-3,5,6-trimethoxy-9-oxo-10H-acridin-2-yl)-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one
| Internal ID | 24b8405b-eae5-43f6-bc49-5bd6b7df0bf9 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
| IUPAC Name | 6,11-dihydroxy-1-(1-hydroxy-3,5,6-trimethoxy-9-oxo-10H-acridin-2-yl)-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
| SMILES (Canonical) | CC1(CC(C2=C(O1)C=C(C3=C2N(C4=C(C3=O)C=CC=C4O)C)O)C5=C(C=C6C(=C5O)C(=O)C7=C(N6)C(=C(C=C7)OC)OC)OC)C |
| SMILES (Isomeric) | CC1(CC(C2=C(O1)C=C(C3=C2N(C4=C(C3=O)C=CC=C4O)C)O)C5=C(C=C6C(=C5O)C(=O)C7=C(N6)C(=C(C=C7)OC)OC)OC)C |
| InChI | InChI=1S/C35H32N2O9/c1-35(2)14-17(24-23(46-35)13-20(39)27-30(24)37(3)29-16(32(27)41)8-7-9-19(29)38)25-22(44-5)12-18-26(33(25)42)31(40)15-10-11-21(43-4)34(45-6)28(15)36-18/h7-13,17,38-39,42H,14H2,1-6H3,(H,36,40) |
| InChI Key | UIEVLPRKYIOBRT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H32N2O9 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.21078060 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
![2D Structure of 6,11-dihydroxy-1-(1-hydroxy-3,5,6-trimethoxy-9-oxo-10H-acridin-2-yl)-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/871f2e20-83e6-11ee-9b56-550664419189.jpg "2D Structure of 6,11-dihydroxy-1-(1-hydroxy-3,5,6-trimethoxy-9-oxo-10H-acridin-2-yl)-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 99.78% | 93.99% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.79% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.54% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.09% | 94.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.78% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.56% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.42% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.90% | 94.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 96.64% | 92.98% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.67% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 92.89% | 92.68% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.79% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.67% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.14% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.11% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.07% | 97.14% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.98% | 95.56% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.27% | 85.49% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.75% | 97.09% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.44% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.62% | 90.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.20% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.85% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.61% | 92.94% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.12% | 93.40% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.73% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |
| PubChem | 15286617 |
| LOTUS | LTS0124409 |
| wikiData | Q105273328 |