[(1S,2R,4S,7R,8S,26R,28S,29R,38S)-1,2,4,13,14,15,18,19,20,34,35-undecahydroxy-5,10,23,31-tetraoxo-6,9,24,27,30,39-hexaoxaoctacyclo[34.2.1.04,38.07,26.08,29.011,16.017,22.032,37]nonatriaconta-11,13,15,17,19,21,32,34,36-nonaen-28-yl] 3,4,5-trihydroxybenzoate
Internal ID | b4d99cc0-9edc-4605-afe1-3f083d7877db |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1S,2R,4S,7R,8S,26R,28S,29R,38S)-1,2,4,13,14,15,18,19,20,34,35-undecahydroxy-5,10,23,31-tetraoxo-6,9,24,27,30,39-hexaoxaoctacyclo[34.2.1.04,38.07,26.08,29.011,16.017,22.032,37]nonatriaconta-11,13,15,17,19,21,32,34,36-nonaen-28-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C2(C3C1(C(=O)OC4C5COC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)OC4C(C(O5)OC(=O)C8=CC(=C(C(=C8)O)O)O)OC(=O)C9=CC(=C(C(=C39)O2)O)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@]2([C@@H]3[C@@]1(C(=O)O[C@@H]4[C@H]5COC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O[C@@H]4[C@H]([C@@H](O5)OC(=O)C8=CC(=C(C(=C8)O)O)O)OC(=O)C9=CC(=C(C(=C39)O2)O)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C40H30O26/c41-12-1-8(2-13(42)22(12)47)33(53)65-37-31-30-28(64-38(57)39(58)6-18(46)40(59)32(39)21-11(36(56)63-31)5-16(45)25(50)29(21)66-40)17(61-37)7-60-34(54)9-3-14(43)23(48)26(51)19(9)20-10(35(55)62-30)4-15(44)24(49)27(20)52/h1-5,17-18,28,30-32,37,41-52,58-59H,6-7H2/t17-,18-,28-,30+,31-,32+,37+,39+,40-/m1/s1 |
InChI Key | LCJOXNIMFDLZJH-HVVSOQOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H30O26 |
Molecular Weight | 926.60 g/mol |
Exact Mass | 926.10253106 g/mol |
Topological Polar Surface Area (TPSA) | 433.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of [(1S,2R,4S,7R,8S,26R,28S,29R,38S)-1,2,4,13,14,15,18,19,20,34,35-undecahydroxy-5,10,23,31-tetraoxo-6,9,24,27,30,39-hexaoxaoctacyclo[34.2.1.04,38.07,26.08,29.011,16.017,22.032,37]nonatriaconta-11,13,15,17,19,21,32,34,36-nonaen-28-yl] 3,4,5-trihydroxybenzoate 2D Structure of [(1S,2R,4S,7R,8S,26R,28S,29R,38S)-1,2,4,13,14,15,18,19,20,34,35-undecahydroxy-5,10,23,31-tetraoxo-6,9,24,27,30,39-hexaoxaoctacyclo[34.2.1.04,38.07,26.08,29.011,16.017,22.032,37]nonatriaconta-11,13,15,17,19,21,32,34,36-nonaen-28-yl] 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/86e8d210-8651-11ee-86e4-9f5db71f4a68.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.99% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.65% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 90.68% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.75% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.67% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.26% | 95.89% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.16% | 96.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.33% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.23% | 96.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.86% | 99.23% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.87% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.53% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.23% | 91.07% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.50% | 92.94% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.42% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 82.01% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 81.11% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.93% | 91.19% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 80.62% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pelargonium reniforme |
PubChem | 162944313 |
LOTUS | LTS0040959 |
wikiData | Q105149868 |