[(1S,4aR,5S,6R,7S,7aS)-6-chloro-7-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] 3,4-dihydroxybenzoate
Internal ID | 7ab89fb6-eeb5-40c8-973e-e3ce356a96f5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [(1S,4aR,5S,6R,7S,7aS)-6-chloro-7-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] 3,4-dihydroxybenzoate |
SMILES (Canonical) | C1=COC(C2C1C(C(C2(CO)O)Cl)OC(=O)C3=CC(=C(C=C3)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=CO[C@H]([C@H]2[C@@H]1[C@@H]([C@H]([C@]2(CO)O)Cl)OC(=O)C3=CC(=C(C=C3)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C22H27ClO13/c23-18-17(35-19(31)8-1-2-10(26)11(27)5-8)9-3-4-33-20(13(9)22(18,32)7-25)36-21-16(30)15(29)14(28)12(6-24)34-21/h1-5,9,12-18,20-21,24-30,32H,6-7H2/t9-,12-,13-,14-,15+,16-,17+,18-,20+,21+,22-/m1/s1 |
InChI Key | MTRQBGBLTPNJPL-LZKNHGLISA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H27ClO13 |
Molecular Weight | 534.90 g/mol |
Exact Mass | 534.1140186 g/mol |
Topological Polar Surface Area (TPSA) | 216.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of [(1S,4aR,5S,6R,7S,7aS)-6-chloro-7-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] 3,4-dihydroxybenzoate 2D Structure of [(1S,4aR,5S,6R,7S,7aS)-6-chloro-7-hydroxy-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-5-yl] 3,4-dihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/86b1bfb0-8612-11ee-a889-d9928a5ff187.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.33% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.77% | 91.49% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.03% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 92.91% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.42% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.76% | 96.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.87% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.90% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.43% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.97% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.97% | 99.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.18% | 97.21% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.14% | 96.90% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.33% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.80% | 96.61% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.92% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.78% | 92.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.46% | 95.83% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.43% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.16% | 89.67% |
CHEMBL2581 | P07339 | Cathepsin D | 81.08% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veronica longifolia |
PubChem | 46938654 |
LOTUS | LTS0125028 |
wikiData | Q105171839 |