2-[(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-9-hydroxy-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-1-yl]prop-2-enal
Internal ID | 4e164315-afff-4daf-81a5-4ce45a37b61b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 2-[(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bS)-9-hydroxy-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-1-yl]prop-2-enal |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1O)C)CCC4C3(CCC5(C4C(CC5)C(=C)C=O)CO)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@]3(CC[C@H]([C@@H]3[C@H]1CC[C@H]4[C@]2(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)C(=C)C=O)CO |
InChI | InChI=1S/C30H48O3/c1-19(17-31)20-9-14-30(18-32)16-15-28(5)21(25(20)30)7-8-23-27(4)12-11-24(33)26(2,3)22(27)10-13-29(23,28)6/h17,20-25,32-33H,1,7-16,18H2,2-6H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
InChI Key | UTUUDDODKUTNLS-ROUWMTJPSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H48O3 |
Molecular Weight | 456.70 g/mol |
Exact Mass | 456.36034539 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 6.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 97.50% | 96.01% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.91% | 97.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.78% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.92% | 96.61% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 89.85% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.76% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.94% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.36% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.66% | 94.75% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.69% | 92.97% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.26% | 92.86% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.20% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.81% | 95.89% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.28% | 85.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.94% | 97.09% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.80% | 96.33% |
CHEMBL2581 | P07339 | Cathepsin D | 81.42% | 98.95% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.05% | 93.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.47% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclolepis genistoides |
PubChem | 70696539 |
LOTUS | LTS0188779 |
wikiData | Q105279116 |