1,8-dihydroxy-4,5-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyxanthen-9-one
Internal ID | 959d67bf-ba22-442f-a3f9-f4a03d95d2fb |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,8-dihydroxy-4,5-dimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyxanthen-9-one |
SMILES (Canonical) | COC1=C2C(=C(C=C1)O)C(=O)C3=C(O2)C(=C(C=C3O)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)OC |
SMILES (Isomeric) | COC1=C2C(=C(C=C1)O)C(=O)C3=C(O2)C(=C(C=C3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O)OC |
InChI | InChI=1S/C26H30O16/c1-36-11-4-3-8(27)14-18(32)15-9(28)5-12(23(37-2)24(15)42-22(11)14)40-26-21(35)19(33)17(31)13(41-26)7-39-25-20(34)16(30)10(29)6-38-25/h3-5,10,13,16-17,19-21,25-31,33-35H,6-7H2,1-2H3/t10-,13-,16+,17-,19+,20-,21-,25+,26-/m1/s1 |
InChI Key | SYNXLCZQPRIZPZ-OOMXKHFZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H30O16 |
Molecular Weight | 598.50 g/mol |
Exact Mass | 598.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.35% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.87% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.00% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.84% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.30% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.13% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.09% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.08% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.02% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.08% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.88% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.28% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.78% | 99.15% |
CHEMBL2535 | P11166 | Glucose transporter | 82.50% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.49% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.76% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.23% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Swertia kouitchensis |
PubChem | 71745142 |
LOTUS | LTS0241063 |
wikiData | Q105263685 |