4-[5-[(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2,3,4-trimethoxyphenoxy]-6-(3,4-dimethoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinoline
| Internal ID | 5fc6d8eb-5524-4069-9857-c1eb1abe0385 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
| IUPAC Name | 4-[5-[(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2,3,4-trimethoxyphenoxy]-6-(3,4-dimethoxyphenyl)-[1,3]dioxolo[4,5-f]isoquinoline |
| SMILES (Canonical) | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3OC)OC)OC)OC4=C5C(=C6C=CN=C(C6=C4)C7=CC(=C(C=C7)OC)OC)OCO5)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3OC)OC)OC)OC4=C5C(=C6C=CN=C(C6=C4)C7=CC(=C(C=C7)OC)OC)OCO5)OC)OC |
| InChI | InChI=1S/C40H42N2O10/c1-42-14-12-22-16-31(45-4)32(46-5)19-26(22)28(42)15-24-18-33(38(48-7)40(49-8)36(24)47-6)52-34-20-27-25(37-39(34)51-21-50-37)11-13-41-35(27)23-9-10-29(43-2)30(17-23)44-3/h9-11,13,16-20,28H,12,14-15,21H2,1-8H3 |
| InChI Key | BTNBYVSAAQKJQG-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H42N2O10 |
| Molecular Weight | 710.80 g/mol |
| Exact Mass | 710.28394554 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 6.80 |
| Atomic LogP (AlogP) | 7.25 |
| H-Bond Acceptor | 12 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 12 |
| RefChem:923811 |
| 241482-19-9 |
| 4-(5-((6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl)-2,3,4-trimethoxyphenoxy)-6-(3,4-dimethoxyphenyl)-(1,3)dioxolo(4,5-f)isoquinoline |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9405 | 94.05% |
| Caco-2 | - | 0.7405 | 74.05% |
| Blood Brain Barrier | + | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.5429 | 54.29% |
| Subcellular localzation | Mitochondria | 0.4416 | 44.16% |
| OATP2B1 inhibitior | - | 0.5580 | 55.80% |
| OATP1B1 inhibitior | + | 0.9157 | 91.57% |
| OATP1B3 inhibitior | + | 0.9315 | 93.15% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.5250 | 52.50% |
| BSEP inhibitior | + | 0.9902 | 99.02% |
| P-glycoprotein inhibitior | + | 0.9259 | 92.59% |
| P-glycoprotein substrate | + | 0.7676 | 76.76% |
| CYP3A4 substrate | + | 0.7135 | 71.35% |
| CYP2C9 substrate | - | 0.6036 | 60.36% |
| CYP2D6 substrate | + | 0.5641 | 56.41% |
| CYP3A4 inhibition | + | 0.8229 | 82.29% |
| CYP2C9 inhibition | - | 0.6477 | 64.77% |
| CYP2C19 inhibition | - | 0.5788 | 57.88% |
| CYP2D6 inhibition | - | 0.7719 | 77.19% |
| CYP1A2 inhibition | - | 0.7731 | 77.31% |
| CYP2C8 inhibition | + | 0.7984 | 79.84% |
| CYP inhibitory promiscuity | + | 0.8416 | 84.16% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.5945 | 59.45% |
| Eye corrosion | - | 0.9899 | 98.99% |
| Eye irritation | - | 0.9272 | 92.72% |
| Skin irritation | - | 0.8179 | 81.79% |
| Skin corrosion | - | 0.9520 | 95.20% |
| Ames mutagenesis | + | 0.5400 | 54.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.9316 | 93.16% |
| Micronuclear | + | 0.5100 | 51.00% |
| Hepatotoxicity | - | 0.6850 | 68.50% |
| skin sensitisation | - | 0.8860 | 88.60% |
| Respiratory toxicity | + | 0.7111 | 71.11% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | - | 0.8354 | 83.54% |
| Acute Oral Toxicity (c) | III | 0.7589 | 75.89% |
| Estrogen receptor binding | + | 0.8618 | 86.18% |
| Androgen receptor binding | + | 0.6405 | 64.05% |
| Thyroid receptor binding | + | 0.6674 | 66.74% |
| Glucocorticoid receptor binding | + | 0.8276 | 82.76% |
| Aromatase binding | + | 0.6727 | 67.27% |
| PPAR gamma | + | 0.7503 | 75.03% |
| Honey bee toxicity | - | 0.7808 | 78.08% |
| Biodegradation | - | 0.9500 | 95.00% |
| Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.9254 | 92.54% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.55% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.24% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.07% | 85.14% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 98.41% | 95.12% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.90% | 95.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.01% | 94.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 95.93% | 95.78% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.40% | 86.33% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 94.08% | 90.95% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 92.75% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 92.71% | 97.53% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 92.58% | 96.69% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.04% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.02% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.66% | 89.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 90.59% | 94.03% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.40% | 92.94% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 90.10% | 92.38% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 89.94% | 92.50% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 89.73% | 92.38% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.39% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.29% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.16% | 89.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.55% | 91.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.45% | 96.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.11% | 92.98% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.09% | 93.10% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.14% | 91.49% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 85.99% | 91.43% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.82% | 93.99% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.49% | 95.71% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 85.45% | 82.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.19% | 95.89% |
| CHEMBL1938212 | Q9UPP1 | Histone lysine demethylase PHF8 | 83.74% | 98.33% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 83.53% | 89.92% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 83.23% | 97.50% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.19% | 96.67% |
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 82.78% | 86.79% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.71% | 88.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.64% | 99.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.61% | 95.83% |
| CHEMBL5903 | Q04771 | Activin receptor type-1 | 82.17% | 89.93% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 80.72% | 87.50% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.68% | 93.65% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.40% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isopyrum thalictroides |
| PubChem | 100981233 |
| LOTUS | LTS0161091 |
| wikiData | Q104945749 |