[17-acetyl-3-[4-hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxy]tetrahydropyran-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-pentanoate
Internal ID | c65bf497-3713-43bf-a061-2da4edbe2342 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [17-acetyl-3-[4-hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]oxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC(C7C(=O)C)OC(=O)CCC(C)COC8C(C(C(C(O8)CO)O)O)O)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC(C7C(=O)C)OC(=O)CCC(C)COC8C(C(C(C(O8)CO)O)O)O)C)C)CO)O)O)O |
InChI | InChI=1S/C51H82O23/c1-20(19-66-46-40(62)39(61)36(58)30(17-52)71-46)7-10-32(55)70-29-16-28-26-9-8-24-15-25(11-13-50(24,5)27(26)12-14-51(28,6)33(29)21(2)54)69-49-45(74-48-42(64)38(60)35(57)23(4)68-48)43(65)44(31(18-53)72-49)73-47-41(63)37(59)34(56)22(3)67-47/h8,20,22-23,25-31,33-49,52-53,56-65H,7,9-19H2,1-6H3 |
InChI Key | OJBSJPFDQZUALV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H82O23 |
Molecular Weight | 1063.20 g/mol |
Exact Mass | 1062.52468886 g/mol |
Topological Polar Surface Area (TPSA) | 360.00 Ų |
XlogP | -2.10 |
[17-acetyl-3-[4-hydroxy-6-(hydroxymethyl)-3,5-bis[(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxy]tetrahydropyran-2-yl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-methyl-5-[3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-pentanoate |
3-((2,4-Bis-O-(6-deoxyhexopyranosyl)hexopyranosyl)oxy)-20-oxopregn-5-en-16-yl 5-(hexopyranosyloxy)-4-methylpentanoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.45% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.14% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.07% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.54% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.53% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.13% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.79% | 92.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.73% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.61% | 95.93% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.41% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.66% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.47% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.44% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.53% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.02% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.98% | 99.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.66% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.37% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.89% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.13% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 81.73% | 97.50% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.00% | 98.46% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.46% | 94.23% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.25% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea collettii |
Dioscorea panthaica |
Dioscorea spongiosa |
PubChem | 496772 |
LOTUS | LTS0171286 |
wikiData | Q105192972 |