8-[2-Hydroxy-6-[2-(3-hydroxyphenyl)ethenyl]-4-methoxyphenyl]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol
| Internal ID | 724e490d-df0e-4a65-81cb-e70a172016bf |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 8-[2-hydroxy-6-[2-(3-hydroxyphenyl)ethenyl]-4-methoxyphenyl]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| SMILES (Canonical) | COC1=CC(=C(C(=C1)O)C2=CC(=C(C3=C2CCC4=C3C=CC(=C4)O)O)OC)C=CC5=CC(=CC=C5)O |
| SMILES (Isomeric) | COC1=CC(=C(C(=C1)O)C2=CC(=C(C3=C2CCC4=C3C=CC(=C4)O)O)OC)C=CC5=CC(=CC=C5)O |
| InChI | InChI=1S/C30H26O6/c1-35-22-14-19(7-6-17-4-3-5-20(31)12-17)28(26(33)15-22)25-16-27(36-2)30(34)29-23-11-9-21(32)13-18(23)8-10-24(25)29/h3-7,9,11-16,31-34H,8,10H2,1-2H3 |
| InChI Key | LQERJUHUFBNBNO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
![2D Structure of 8-[2-Hydroxy-6-[2-(3-hydroxyphenyl)ethenyl]-4-methoxyphenyl]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/85f052b0-81e8-11ee-8052-2b0b4babd364.jpg "2D Structure of 8-[2-Hydroxy-6-[2-(3-hydroxyphenyl)ethenyl]-4-methoxyphenyl]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.75% | 95.56% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.56% | 98.35% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.47% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.35% | 96.09% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.47% | 91.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.83% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.76% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.54% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.16% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.02% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 90.11% | 89.76% |
| CHEMBL267 | P12931 | Tyrosine-protein kinase SRC | 90.05% | 95.69% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.01% | 95.89% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.01% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.97% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.52% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.05% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.55% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.26% | 89.62% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.50% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.45% | 99.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.43% | 91.07% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 84.58% | 81.29% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.11% | 98.11% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 81.79% | 89.32% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.48% | 94.73% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 80.79% | 83.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.35% | 93.99% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.30% | 99.18% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.25% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pholidota chinensis |
| PubChem | 163084801 |
| LOTUS | LTS0235540 |
| wikiData | Q105155490 |